Preferred Name |
phencyclidine |
|
Synonyms |
1-(1-phenylcyclohexyl)piperidine fenciclidina PCP Phencyclidine phencyclidine phencyclidinum C17H25N |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8058 |
|
blocks | ||
CASRN |
77-10-1 |
|
DBname |
phencyclidine |
|
DBSynonym |
stardust elephant tranquilizer 1-(1-phenylcyclohexyl)piperidine hydrochloride zombie dust busy bee phencyclidinum [inn-latin] 1-(1-phenylcyclohexyl)piperidine sernyl supergrass tic crystal phencyclidine hydrochloride magic mist sernylan dust fenciclidina [inn-spanish] whack rocket fuel cadillac tranks phenylcyclidine hydrochloride angel dust trank cjs surfer |
|
Definition |
A piperidine derivative in which the nitrogen is substituted with a 1-phenylcyclohexyl group. Formerly used as an anaesthetic agent, it exhibits both hallucinogenic and neurotoxic effects. |
|
has pharmacological target | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35471 http://purl.obolibrary.org/obo/CHEBI_38867 |
|
InChI |
InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2 |
|
InChIKey |
InChIKey=JTJMJGYZQZDUJJ-UHFFFAOYSA-N |
|
inhibits | ||
label |
phencyclidine |
|
prefixIRI |
obo2:CHEBI_8058 |
|
prefLabel |
phencyclidine |
|
related with | ||
SMILES |
C1CCN(CC1)C1(CCCCC1)C1=CC=CC=C1 C1CCN(CC1)C1(CCCCC1)c1ccccc1 |
|
Synonym |
1-(1-phenylcyclohexyl)piperidine fenciclidina PCP Phencyclidine phencyclidine phencyclidinum C17H25N |
|
xref |
CiteXplore:7250199 CiteXplore:10696810 CiteXplore:22467667 PharmGKB:PA128406980 Wikipedia:Phencyclidine CiteXplore:8103992 CiteXplore:9786848 CiteXplore:7968937 DrugBank:DB03575 PDB:1PC ChemSpider:6224 CiteXplore:9007505 KEGG COMPOUND:C07575 CiteXplore:12206280 CASRN:77-10-1 Drugs.com:http://www.drugs.com/phencyclidine.html PubChem Substance:46508889 PubChem Compound:6468 Reaxys:20976544 CiteXplore:17265073 Wikipedia:http://en.wikipedia.org/wiki/Phencyclidine CiteXplore:10379517 ChEMBL:105666 CiteXplore:8855512 |
|
subClassOf |