Preferred Name |
sotalol |
|
Synonyms |
C12H20N2O3S beta-cardone sotalol N-(4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}phenyl)methanesulfonamide sotalolum N-{4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl}methanesulfonamide 4'-(1-hydroxy-2-(isopropylamino)ethyl)methane sulfonanilide Sotalol |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63622 |
|
AHFScode |
24:24.00 |
|
altId |
CHEBI:9206 |
|
ATCCode |
C07AA57 C07AA07 |
|
blocks | ||
CASRN |
3930-20-9 |
|
DBBrand |
betapace betapace af sorine |
|
DBname |
sotalol |
|
DBSynonym |
sotalol hcl |
|
Definition |
A sulfonamide that is N-phenylmethanesulfonamide in which the phenyl group is sustituted at position 4 by a 1-hydroxy-2-(isopropylamino)ethyl group. It has both beta-adrenoreceptor blocking (Vaughan Williams Class II) and cardiac action potential duration prolongation (Vaughan Williams Class III) antiarrhythmic properties. It is used (usually as the hydrochloride salt) for the management of ventricular and supraventricular arrhythmias. |
|
has pharmacological target |
http://purl.obolibrary.org/obo/dinto_2907 |
|
has role | ||
InChI |
InChI=1S/C12H20N2O3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3 |
|
InChIKey |
InChIKey=ZBMZVLHSJCTVON-UHFFFAOYSA-N |
|
inhibits | ||
label |
sotalol |
|
prefixIRI |
obo2:CHEBI_63622 |
|
prefLabel |
sotalol |
|
SMILES |
CC(C)NCC(O)C1=CC=C(NS(C)(=O)=O)C=C1 CC(C)NCC(O)c1ccc(NS(C)(=O)=O)cc1 |
|
Synonym |
C12H20N2O3S beta-cardone sotalol N-(4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}phenyl)methanesulfonamide sotalolum N-{4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl}methanesulfonamide 4'-(1-hydroxy-2-(isopropylamino)ethyl)methane sulfonanilide Sotalol |
|
xref |
KEGG COMPOUND:C07309 PubChem Substance:46505012 ChEMBL:105528 National Drug Code Directory:0245-0012-11 RxList:http://www.rxlist.com/cgi/generic/betapaceaf.htm Reaxys:2380820 Drugs.com:http://www.drugs.com/cdi/sotalol.html CiteXplore:21553267 Drugs Product Database (DPD):2257858 CASRN:3930-20-9 KEGG DRUG:D08525 PharmGKB:PA451457 Wikipedia:http://en.wikipedia.org/wiki/Sotalol CiteXplore:20562595 DrugBank:DB00489 CiteXplore:21854895 BindingDB:25762 Wikipedia:Sotalol PubChem Compound:5253 ChemSpider:5063 |
|
subClassOf |