loading...| Preferred Name |
arformoterol |
|
| Synonyms |
(-)-formoterol C19H24N2O4 N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide (R,R)-formoterol arformoterol |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_408174 |
|
| activates | ||
| AHFScode |
12:12.08.12 |
|
| ATCCode |
R03AC13 |
|
| CASRN |
67346-49-0 |
|
| DBBrand |
brovana |
|
| DBname |
arformoterol |
|
| DBSynonym |
(r,r)-formoterol |
|
| Definition |
An N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide in which both of the stereocentres have R configuration. The active enantiomer of formoterol, it is administered by inhalation (generally as the tartrate salt) as a direct-acting sympathomimetic and bronchodilator for the treatment of chronic obstructive pulmonary disease (any progressive respiratory disease that makes it harder to breathe over time, such as chronic bronchitis and emphysema). |
|
| has pharmacological target | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35522 |
|
| InChI |
InChI=1S/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/t13-,19+/m1/s1 |
|
| InChIKey |
InChIKey=BPZSYCZIITTYBL-YJYMSZOUSA-N |
|
| is metabolised by |
http://purl.obolibrary.org/obo/dinto_2058 http://purl.obolibrary.org/obo/dinto_2993 |
|
| label |
arformoterol |
|
| prefixIRI |
obo2:CHEBI_408174 |
|
| prefLabel |
arformoterol |
|
| SMILES |
[H]C(=O)Nc1cc(ccc1O)[C@@H](O)CN[C@H](C)Cc1ccc(OC)cc1 COC1=CC=C(C[C@@H](C)NC[C@H](O)C2=CC(NC=O)=C(O)C=C2)C=C1 |
|
| Synonym |
(-)-formoterol C19H24N2O4 N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide (R,R)-formoterol arformoterol |
|
| xref |
Drugs.com:http://www.drugs.com/cdi/arformoterol.html CASRN:67346-49-0 DrugBank:67346-49-0 BindingDB:50151720 RxList:http://www.rxlist.com/cgi/generic/brovana.htm ChemSpider:2340731 DrugBank:DB01274 ChEMBL:15324892 PubChem Substance:46506392 PharmGKB:PA164743977 CiteXplore:20214460 CiteXplore:20406080 Beilstein:7861827 PubChem Compound:3083544 National Drug Code Directory:63402-911-30 ChEBI:408174 KEGG DRUG:D07463 CiteXplore:18990965 Patent:US2011014246 |
|
| subClassOf |