loading...| Preferred Name |
cytisine |
|
| Synonyms |
baptitoxine sophorine laburnin (-)-cytisine sophorin C11H14N2O baptitoxin (1R,5S)-1,2,3,4,5,6-hexahydro-8H-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4055 |
|
| Definition |
An organic heterotricyclic compound that is the toxic principle in Laburnum seeds and is found in many members of the Fabaceae (legume, pea or bean) family. An acetylcholine agonist, it is widely used throughout Eastern Europe as an aid to giving up smoking. |
|
| has role | ||
| InChI |
InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
|
| InChIKey |
InChIKey=ANJTVLIZGCUXLD-DTWKUNHWSA-N |
|
| label |
cytisine |
|
| prefixIRI |
obo2:CHEBI_4055 |
|
| prefLabel |
cytisine |
|
| SMILES |
O=c1cccc2[C@H]3CNC[C@H](C3)Cn12 |
|
| Synonym |
baptitoxine sophorine laburnin (-)-cytisine sophorin C11H14N2O baptitoxin (1R,5S)-1,2,3,4,5,6-hexahydro-8H-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one |
|
| xref |
CASRN:485-35-8 CiteXplore:23022271 ChEMBL:622894 CiteXplore:22367109 Reaxys:83882 CiteXplore:22250168 CiteXplore:21991893 KEGG COMPOUND:C10763 CiteXplore:21217866 Wikipedia:Cytisine CiteXplore:23601929 CiteXplore:23404838 KEGG DRUG:D07770 CiteXplore:22090039 NIST Chemistry WebBook:485-35-8 |
|
| subClassOf |