Preferred Name |
chlormezanone |
|
Synonyms |
chlormethazanone 2-(4-chlorophenyl)-3-methyl-1,3-thiazinan-4-one 1,1-dioxide 2-(p-chlorophenyl)tetrahydro-3-methyl-4H-1,3-thiazin-4-one 1,1-dioxide chlormezanona 2-(4-chlorophenyl)-3-methyl-1$l^{6},3-thiazinane-1,1,4-trione (+-)-chlormezanone chlormezanonum 2-(p-chlorphenyl)-3-methyl-1,3-perhydrothiazin-4-on-1,1-dioxide chlormezanone C11H12ClNO3S |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3619 |
|
activates | ||
ATCCode |
M03BB02 |
|
CASRN |
80-77-3 |
|
DBBrand |
muskel banabin-sintyal rilasol rilax mio-sed alinam banabil-sintyal rillasol lobak clorilax phenarol transanate miorilax rilassol rilaquil myolespen tranrilax suprotan rilansyl rexan chlomedinon trancote bisina tanafol trancopal supotran muskel-trancopal banabin banabin-syntyal |
|
DBname |
chlormezanone |
|
DBSynonym |
chlormezanon dichloromethazanone chlormethazanone dl-chlormezanone chlormezanonum [inn-latin] clormetazanone chlormethazone clormezanona [inn-spanish] dichloromezanone clormezanone [dcit] clormetazon chlormezanone [ban:inn:jan] |
|
Definition |
A 1,3-thiazine that is 1,3-thiazinan-4-one S,S-dioxide in which a hydrogen at position 2 is substituted by a 4-chlorophenyl group and the hydrogen attached to the nitrogen is substituted by methyl. A non-benzodiazepine muscle relaxant, it was used in the management of anxiety and in the treatment of muscle spasms until being discontinued worldwide by its manufacturer in 1996, due to rare but serious cutaneous reactions. |
|
has pharmacological target | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_51371 |
|
InChI |
InChI=1S/C11H12ClNO3S/c1-13-10(14)6-7-17(15,16)11(13)8-2-4-9(12)5-3-8/h2-5,11H,6-7H2,1H3 |
|
InChIKey |
InChIKey=WEQAYVWKMWHEJO-UHFFFAOYSA-N |
|
label |
chlormezanone |
|
prefixIRI |
obo2:CHEBI_3619 |
|
prefLabel |
chlormezanone |
|
SMILES |
CN1C(C2=CC=C(Cl)C=C2)S(=O)(=O)CCC1=O CN1C(c2ccc(Cl)cc2)S(=O)(=O)CCC1=O |
|
Synonym |
chlormethazanone 2-(4-chlorophenyl)-3-methyl-1,3-thiazinan-4-one 1,1-dioxide 2-(p-chlorophenyl)tetrahydro-3-methyl-4H-1,3-thiazin-4-one 1,1-dioxide chlormezanona 2-(4-chlorophenyl)-3-methyl-1$l^{6},3-thiazinane-1,1,4-trione (+-)-chlormezanone chlormezanonum 2-(p-chlorphenyl)-3-methyl-1,3-perhydrothiazin-4-on-1,1-dioxide chlormezanone C11H12ClNO3S |
|
xref |
DrugBank:DB01178 Patent:GB815203 KEGG DRUG:D00268 PubChem Substance:46505352 Reaxys:23033 ChemSpider:2616 CASRN:80-77-3 Wikipedia:Chlormezanone Beilstein:23033 ChEMBL:774665 PubChem Compound:2717 Wikipedia:http://en.wikipedia.org/wiki/Chlormezanone ChEBI:3619 PharmGKB:PA448939 |
|
subClassOf |