The Drug-Drug Interactions Ontology

Last uploaded: February 11, 2016
Preferred Name

amphotericin B

Synonyms

(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,33R,35S,36R,37S)-33-{[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy}-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid

C47H73NO17

Amphotericine B

AMPH-B

amfotericina B

amphotericine B

amphotericinum B

(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid

amphotericin B

Liposomal Amphotericin B

ID

http://purl.obolibrary.org/obo/CHEBI_2682

AHFScode

08:14.28

altId

CHEBI:566395

CHEBI:106303

ATCCode

G01AA03

J02AA01

A07AA07

A01AB04

binds

http://purl.obolibrary.org/obo/dinto_2970

CASRN

1397-89-3

DBBrand

tegopen

sinunase

hsdb 3008 iab

halizon

fungizone

fungizone intravenous

ablc

ampho-moronal

fungilin

amphocin

mysteclin-f

lns-amb

amphotec

fungisone

amphotericin

amphozone

abelcet

ambisome

DBname

amphotericin b

DBSynonym

amphortericin b

liposomal amphotericin b

amph-b

amphotericine b

Definition

A macrolide antibiotic used to treat potentially life-threatening fungal infections.

has effect

http://purl.obolibrary.org/obo/OAE_0000426

http://purl.obolibrary.org/obo/OAE_0001057

http://purl.obolibrary.org/obo/OAE_0000494

http://purl.obolibrary.org/obo/OAE_0000505

http://purl.obolibrary.org/obo/OAE_0000355

http://purl.obolibrary.org/obo/OAE_0000573

http://purl.obolibrary.org/obo/OAE_0000411

http://purl.obolibrary.org/obo/OAE_0000400

http://purl.obolibrary.org/obo/OAE_0000549

http://purl.obolibrary.org/obo/OAE_0000770

http://purl.obolibrary.org/obo/OAE_0001068

http://purl.obolibrary.org/obo/OAE_0000390

http://purl.obolibrary.org/obo/OAE_0000401

http://purl.obolibrary.org/obo/OAE_0000412

http://purl.obolibrary.org/obo/OAE_0000377

http://purl.obolibrary.org/obo/OAE_0001345

http://purl.obolibrary.org/obo/OAE_0000632

http://purl.obolibrary.org/obo/OAE_0000608

http://purl.obolibrary.org/obo/OAE_0000567

http://purl.obolibrary.org/obo/OAE_0000218

http://purl.obolibrary.org/obo/OAE_0001509

http://purl.obolibrary.org/obo/OAE_0000935

http://purl.obolibrary.org/obo/OAE_0001129

http://purl.obolibrary.org/obo/OAE_0001035

http://purl.obolibrary.org/obo/OAE_0000920

http://purl.obolibrary.org/obo/OAE_0000496

http://purl.obolibrary.org/obo/OAE_0000875

http://purl.obolibrary.org/obo/OAE_0000659

http://purl.obolibrary.org/obo/OAE_0001437

http://purl.obolibrary.org/obo/OAE_0000391

http://purl.obolibrary.org/obo/OAE_0001448

http://purl.obolibrary.org/obo/OAE_0001025

http://purl.obolibrary.org/obo/OAE_0001070

http://purl.obolibrary.org/obo/OAE_0000300

http://purl.obolibrary.org/obo/OAE_0001046

http://purl.obolibrary.org/obo/OAE_0001291

http://purl.obolibrary.org/obo/OAE_0001449

http://purl.obolibrary.org/obo/OAE_0000268

http://purl.obolibrary.org/obo/OAE_0000600

http://purl.obolibrary.org/obo/OAE_0000611

http://purl.obolibrary.org/obo/OAE_0000902

http://purl.obolibrary.org/obo/OAE_0000533

http://purl.obolibrary.org/obo/OAE_0000545

http://purl.obolibrary.org/obo/OAE_0000385

http://purl.obolibrary.org/obo/OAE_0001489

http://purl.obolibrary.org/obo/OAE_0000557

http://purl.obolibrary.org/obo/OAE_0000406

http://purl.obolibrary.org/obo/OAE_0001013

http://purl.obolibrary.org/obo/OAE_0001707

http://purl.obolibrary.org/obo/OAE_0000396

http://purl.obolibrary.org/obo/OAE_0000418

http://purl.obolibrary.org/obo/OAE_0001003

http://purl.obolibrary.org/obo/OAE_0000604

http://purl.obolibrary.org/obo/OAE_0001742

http://purl.obolibrary.org/obo/OAE_0000434

http://purl.obolibrary.org/obo/OAE_0001538

http://purl.obolibrary.org/obo/OAE_0001135

http://purl.obolibrary.org/obo/OAE_0000491

http://purl.obolibrary.org/obo/OAE_0000894

http://purl.obolibrary.org/obo/OAE_0000468

http://purl.obolibrary.org/obo/OAE_0000811

http://purl.obolibrary.org/obo/OAE_0000501

http://purl.obolibrary.org/obo/OAE_0000512

http://purl.obolibrary.org/obo/OAE_0000386

http://purl.obolibrary.org/obo/OAE_0000780

http://purl.obolibrary.org/obo/OAE_0000375

http://purl.obolibrary.org/obo/OAE_0000306

http://purl.obolibrary.org/obo/OAE_0000374

http://purl.obolibrary.org/obo/OAE_0000630

http://purl.obolibrary.org/obo/OAE_0000250

http://purl.obolibrary.org/obo/OAE_0000617

http://purl.obolibrary.org/obo/OAE_0002206

http://purl.obolibrary.org/obo/OAE_0001364

http://purl.obolibrary.org/obo/OAE_0001515

http://purl.obolibrary.org/obo/OAE_0000674

http://purl.obolibrary.org/obo/OAE_0000586

http://purl.obolibrary.org/obo/OAE_0000587

http://purl.obolibrary.org/obo/OAE_0000493

http://purl.obolibrary.org/obo/OAE_0000597

http://purl.obolibrary.org/obo/OAE_0000365

http://purl.obolibrary.org/obo/OAE_0000343

http://purl.obolibrary.org/obo/OAE_0000447

http://purl.obolibrary.org/obo/OAE_0000319

http://purl.obolibrary.org/obo/OAE_0000691

http://purl.obolibrary.org/obo/OAE_0001369

http://purl.obolibrary.org/obo/OAE_0000376

http://purl.obolibrary.org/obo/OAE_0000194

http://purl.obolibrary.org/obo/OAE_0001298

http://purl.obolibrary.org/obo/OAE_0000084

http://purl.obolibrary.org/obo/OAE_0000487

http://purl.obolibrary.org/obo/OAE_0000508

http://purl.obolibrary.org/obo/OAE_0000382

http://purl.obolibrary.org/obo/OAE_0000403

http://purl.obolibrary.org/obo/OAE_0000414

http://purl.obolibrary.org/obo/OAE_0001059

http://purl.obolibrary.org/obo/OAE_0000460

http://purl.obolibrary.org/obo/OAE_0000402

http://purl.obolibrary.org/obo/OAE_0000021

http://purl.obolibrary.org/obo/OAE_0000415

http://purl.obolibrary.org/obo/OAE_0000601

http://purl.obolibrary.org/obo/OAE_0000310

http://purl.obolibrary.org/obo/OAE_0000984

http://purl.obolibrary.org/obo/OAE_0001370

http://purl.obolibrary.org/obo/OAE_0001336

http://purl.obolibrary.org/obo/OAE_0000645

http://purl.obolibrary.org/obo/OAE_0000453

http://purl.obolibrary.org/obo/OAE_0001208

http://purl.obolibrary.org/obo/OAE_0000647

http://purl.obolibrary.org/obo/OAE_0001190

http://purl.obolibrary.org/obo/OAE_0001166

http://purl.obolibrary.org/obo/OAE_0000465

http://purl.obolibrary.org/obo/OAE_0001189

http://purl.obolibrary.org/obo/OAE_0000038

http://purl.obolibrary.org/obo/OAE_0001026

http://purl.obolibrary.org/obo/OAE_0000394

http://purl.obolibrary.org/obo/OAE_0000350

http://purl.obolibrary.org/obo/OAE_0001062

http://purl.obolibrary.org/obo/OAE_0000687

http://purl.obolibrary.org/obo/OAE_0000476

http://purl.obolibrary.org/obo/OAE_0000283

http://purl.obolibrary.org/obo/OAE_0000395

http://purl.obolibrary.org/obo/OAE_0000211

http://purl.obolibrary.org/obo/OAE_0000660

http://purl.obolibrary.org/obo/OAE_0000602

http://purl.obolibrary.org/obo/OAE_0000536

http://purl.obolibrary.org/obo/OAE_0000210

http://purl.obolibrary.org/obo/OAE_0001055

http://purl.obolibrary.org/obo/OAE_0000561

http://purl.obolibrary.org/obo/OAE_0000388

http://purl.obolibrary.org/obo/OAE_0000584

http://purl.obolibrary.org/obo/OAE_0001443

http://purl.obolibrary.org/obo/OAE_0000779

http://purl.obolibrary.org/obo/OAE_0000419

http://purl.obolibrary.org/obo/OAE_0001365

http://purl.obolibrary.org/obo/OAE_0000455

http://purl.obolibrary.org/obo/OAE_0000362

http://purl.obolibrary.org/obo/OAE_0000304

http://purl.obolibrary.org/obo/OAE_0000782

http://purl.obolibrary.org/obo/OAE_0000607

http://purl.obolibrary.org/obo/OAE_0000618

http://purl.obolibrary.org/obo/OAE_0000373

http://purl.obolibrary.org/obo/OAE_0000551

has pharmacological target

http://purl.obolibrary.org/obo/dinto_2970

has role

http://purl.obolibrary.org/obo/CHEBI_35718

http://purl.obolibrary.org/obo/CHEBI_35820

InChI

InChI=1S/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1

InChIKey

InChIKey=APKFDSVGJQXUKY-INPOYWNPSA-N

label

amphotericin B

prefixIRI

obo2:CHEBI_2682

prefLabel

amphotericin B

SMILES

[H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)\C=C\\C=C\\C=C\\C=C\\C=C\\C=C\\C=C\\[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(O)=O)O2

[H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)C=C\C=C\C=C\C=C\C=C\C=C\C=C\[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(O)=O)O2

Synonym

(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,33R,35S,36R,37S)-33-{[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy}-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid

C47H73NO17

Amphotericine B

AMPH-B

amfotericina B

amphotericine B

amphotericinum B

(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid

amphotericin B

Liposomal Amphotericin B

xref

ChEMBL:1732516

Beilstein:4645978

ChemSpider:14245

Patent:US2908611

CiteXplore:11429202

KEGG COMPOUND:C06573

Reaxys:4645978

Drugs.com:http://www.drugs.com/cdi/amphotericin-b.html

CASRN:1397-89-3

PharmGKB:PA448415

KEGG DRUG:D00203

ChEMBL:108873

PubChem Substance:46505473

Wikipedia:http://en.wikipedia.org/wiki/Amphotericin_B

RxList:http://www.rxlist.com/cgi/generic2/amphoter.htm

PubChem Compound:5280965

Wikipedia:Amphotericin_B

LIPID MAPS:LMPK06000002

CiteXplore:16793999

CiteXplore:16120633

DrugBank:DB00681

DrugBank:1397-89-3

Drugs Product Database (DPD):29149

ChEMBL:17507115

National Drug Code Directory:0469-3051-30

subClassOf

http://purl.obolibrary.org/obo/dinto_000055

Delete Subject Author Type Created
No notes to display
Create New Mapping

Delete Mapping To Ontology Source
http://stirdf.jst.go.jp/id/200907033675065913 IOBC LOOM
http://purl.bioontology.org/ontology/UATC/A07AA07 ATC LOOM
http://purl.bioontology.org/ontology/UATC/G01AA03 ATC LOOM
http://purl.obolibrary.org/obo/DDO.owl#DDO_0005038 DDO LOOM
http://purl.obolibrary.org/obo/DDO.owl#DDO_0005038 DMTO LOOM
http://purl.bioontology.org/ontology/NDFRT/N0000145996 NDFRT LOOM
http://sbmi.uth.tmc.edu/ontology/ochv#C0002679 OCHV LOOM
http://purl.bioontology.org/ontology/SNMI/C-52B20 SNMI LOOM
http://purl.bioontology.org/ontology/LNC/MTHU006779 LOINC LOOM
http://purl.bioontology.org/ontology/SNOMEDCT/77703004 SNOMEDCT LOOM
http://purl.bioontology.org/ontology/RXNORM/732 RXNORM LOOM
http://purl.jp/bio/4/id/200906088655935976 IOBC LOOM
http://phenomebrowser.net/ontologies/mesh/mesh.owl#D000666 RH-MESH LOOM
http://phenomebrowser.net/ontologies/mesh/mesh.owl#D02.540.505.050 RH-MESH LOOM
http://purl.bioontology.org/ontology/LNC/LP15581-9 LOINC LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 PHIPO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 PHIPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 BIOMODELS LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 BIOMODELS SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EFO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 EFO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EUPATH LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 EUPATH SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CCONT LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 CCONT SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 DRON SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EFO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 EFO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://sbmi.uth.tmc.edu/ontology/ochv#1050 OCHV LOOM
http://purl.bioontology.org/ontology/MESH/D000666 MESH LOOM
http://purl.bioontology.org/ontology/UATC/A01AB04 ATC LOOM
http://purl.bioontology.org/ontology/UATC/J02AA01 ATC LOOM
http://bmi.utah.edu/ontologies/hfontology/C0002679 HFO LOOM
http://purl.bioontology.org/ontology/CSP/0191-9825 CRISP LOOM
http://purl.bioontology.org/ontology/NDDF/002887 NDDF LOOM
http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C238 NCIT LOOM
http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C238 NCIT LOOM
http://www.gamuts.net/entity#amphotericin_B GAMUTS LOOM
http://purl.bioontology.org/ontology/VANDF/4017616 VANDF LOOM