loading...| Preferred Name |
anagrelide |
|
| Synonyms |
C10H7Cl2N3O anagrelide anagrelida anagrelidum 6,7-dichloro-1,5-dihydroimidazo[2,1-]quinazolin-2(3H)-one 6,7-dichloro-1H,2H,3H,5H-imidazolidino[2,1-b]quinazolin-2-one |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_142290 |
|
| AHFScode |
10:00.00 92:00.00 |
|
| ATCCode |
L01XX35 |
|
| CASRN |
68475-42-3 |
|
| DBBrand |
xagrid agrylin |
|
| DBname |
anagrelide |
|
| DBSynonym |
anagrelide hcl bl-4162a anagrelide hydrochloride |
|
| Definition |
A 1,5-dihydroimidazo[2,1-]quinazoline having an oxo substituent at the 2-position and chloro substituents at the 6- and 7-positions. |
|
| has pharmacological target | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_50249 http://purl.obolibrary.org/obo/CHEBI_48675 |
|
| InChI |
InChI=1S/C10H7Cl2N3O/c11-6-1-2-7-5(9(6)12)3-15-4-8(16)14-10(15)13-7/h1-2H,3-4H2,(H,13,14,16) |
|
| InChIKey |
InChIKey=OTBXOEAOVRKTNQ-UHFFFAOYSA-N |
|
| inhibits | ||
| is metabolised by | ||
| label |
anagrelide |
|
| may interact with | ||
| prefixIRI |
obo2:CHEBI_142290 |
|
| prefLabel |
anagrelide |
|
| SMILES |
ClC1=CC=C2N=C3NC(=O)CN3CC2=C1Cl Clc1ccc2N=C3NC(=O)CN3Cc2c1Cl |
|
| Synonym |
C10H7Cl2N3O anagrelide anagrelida anagrelidum 6,7-dichloro-1,5-dihydroimidazo[2,1-]quinazolin-2(3H)-one 6,7-dichloro-1H,2H,3H,5H-imidazolidino[2,1-b]quinazolin-2-one |
|
| xref |
Drugs Product Database (DPD):2260107 Wikipedia:http://en.wikipedia.org/wiki/Anagrelide ChEBI:142290 KEGG DRUG:D07455 PharmGKB:PA164742986 BindingDB:50000334 Wikipedia:Anagrelide Drugs.com:http://www.drugs.com/cdi/anagrelide.html CASRN:68475-42-3 DrugBank:68475-42-3 Beilstein:619582 National Drug Code Directory:0378-6868-01 DrugBank:DB00261 |
|
| subClassOf |