Preferred Name |
bupropion |
|
Synonyms |
2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one Bupropion 239.108 CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1 C13H18ClNO InChI=1S/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3 SNPPWIUOZRMYNY-UHFFFAOYSA-N 0 239.74086 |
|
Definitions |
A propanone that is propan-1-one substituted by a tert-butylamino group at position 2 and a 3-chlorophenyl group at position 1. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3219 |
|
database_cross_reference |
Beilstein:2101062 CAS:34911-55-2 MetaCyc:CPD-3481 PMID:12826985 KEGG:D07591 Wikipedia:Bupropion Drug_Central:435 HMDB:HMDB01510 PMID:15876900 Reaxys:2101062 DrugBank:DB01156 KEGG:C06860 CAS:34841-39-9 LINCS:LSM-1267 |
|
has_exact_synonym |
2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one Bupropion |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
239.108 CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1 C13H18ClNO InChI=1S/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3 SNPPWIUOZRMYNY-UHFFFAOYSA-N 0 239.74086 |
|
id |
CHEBI:3219 |
|
imported from | ||
in_subset | ||
label |
bupropion |
|
notation |
CHEBI:3219 |
|
prefLabel |
bupropion |
|
textual definition |
A propanone that is propan-1-one substituted by a tert-butylamino group at position 2 and a 3-chlorophenyl group at position 1. |
|
subClassOf |