Preferred Name |
trichlormethiazide |
|
Synonyms |
6-chloro-3-(dichloromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide hydrotrichlorothiazide trichlormethiazide triclormetiazida trichlormethiazidum |
|
Definitions |
A benzothiadiazine, hydrogenated at positions 2, 3 and 4 and substituted with an aminosulfonyl group at C-7, a chloro substituent at C-6 and a dichloromethyl group at C-3 and with S-1 as an S,S-dioxide. A sulfonamide antibiotic, it is used as a diuretic to treat oedema (including that associated with heart failure) and hypertension. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9683 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Trichlormethiazide PMID:25938807 KEGG:C07767 PMID:28166217 CAS:133-67-5 Drug_Central:2733 LINCS:LSM-4383 PMID:28089902 PMID:25692026 DrugBank:DB01021 PMID:24678944 PMID:21605415 KEGG:D00658 PMID:29438107 |
|
definition |
A benzothiadiazine, hydrogenated at positions 2, 3 and 4 and substituted with an aminosulfonyl group at C-7, a chloro substituent at C-6 and a dichloromethyl group at C-3 and with S-1 as an S,S-dioxide. A sulfonamide antibiotic, it is used as a diuretic to treat oedema (including that associated with heart failure) and hypertension. |
|
formula |
C8H8Cl3N3O4S2 |
|
has role | ||
has_exact_synonym |
6-chloro-3-(dichloromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
hydrotrichlorothiazide trichlormethiazide triclormetiazida trichlormethiazidum |
|
id |
CHEBI:9683 |
|
in_subset | ||
inchi |
InChI=1S/C8H8Cl3N3O4S2/c9-3-1-4-6(2-5(3)19(12,15)16)20(17,18)14-8(13-4)7(10)11/h1-2,7-8,13-14H,(H2,12,15,16) |
|
inchikey |
LMJSLTNSBFUCMU-UHFFFAOYSA-N |
|
label |
trichlormethiazide |
|
mass |
380.658 |
|
monoisotopicmass |
378.90218 |
|
notation |
CHEBI:9683 |
|
prefLabel |
trichlormethiazide |
|
smiles |
C12=C(NC(C(Cl)Cl)NS1(=O)=O)C=C(Cl)C(=C2)S(N)(=O)=O |
|
treeView | ||
subClassOf |