loading...| Preferred Name |
tolazamide |
|
| Synonyms |
N-(azepan-1-ylcarbamoyl)-4-methylbenzenesulfonamide 1-(hexahydro-1H-azepin-1-yl)-3-(p-tolylsulfonyl)urea Norglycin U-17835 N-{[(hexahydro-1H-azepin-1-yl)-amino]carbonyl}-4-methylbenzenesulfonamide Diabewas CCRIS 591 Tolinase BRN 1323565 1-(hexahydro-1-azepinyl)-3-p-tolylsulfonylurea 4-(p-tolylsulfonyl)-1,1-hexamethylenesemicarbazide U 17835 EINECS 214-588-3 tolazamide N-(p-toluenesulfonyl)-N'-hexamethyleniminourea tolazamida tolazamidum |
|
| Definitions |
An N-sulfonylurea that is 1-tosylurea in which a hydrogen attached to the nitrogen at position 3 is replaced by an azepan-1-yl group. A hypoglycemic agent, it is used for the treatment of type 2 diabetes mellitus. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9613 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00379 HMDB:HMDB0014977 Drug_Central:2694 PMID:15901207 LINCS:LSM-2699 Reaxys:1323565 PMID:8237731 Patent:GB887886 DrugBank:DB00839 Wikipedia:Tolazamide CAS:1156-19-0 |
|
| definition |
An N-sulfonylurea that is 1-tosylurea in which a hydrogen attached to the nitrogen at position 3 is replaced by an azepan-1-yl group. A hypoglycemic agent, it is used for the treatment of type 2 diabetes mellitus. |
|
| formula |
C14H21N3O3S |
|
| has role | ||
| has_exact_synonym |
N-(azepan-1-ylcarbamoyl)-4-methylbenzenesulfonamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-(hexahydro-1H-azepin-1-yl)-3-(p-tolylsulfonyl)urea Norglycin U-17835 N-{[(hexahydro-1H-azepin-1-yl)-amino]carbonyl}-4-methylbenzenesulfonamide Diabewas CCRIS 591 Tolinase BRN 1323565 1-(hexahydro-1-azepinyl)-3-p-tolylsulfonylurea 4-(p-tolylsulfonyl)-1,1-hexamethylenesemicarbazide U 17835 EINECS 214-588-3 tolazamide N-(p-toluenesulfonyl)-N'-hexamethyleniminourea tolazamida tolazamidum |
|
| id |
CHEBI:9613 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18) |
|
| inchikey |
OUDSBRTVNLOZBN-UHFFFAOYSA-N |
|
| label |
tolazamide |
|
| mass |
311.40000 |
|
| monoisotopicmass |
311.13036 |
|
| notation |
CHEBI:9613 |
|
| prefLabel |
tolazamide |
|
| smiles |
Cc1ccc(cc1)S(=O)(=O)NC(=O)NN1CCCCCC1 |
|
| treeView | ||
| subClassOf |