Preferred Name |
tetracaine |
|
Synonyms |
2-(dimethylamino)ethyl 4-(butylamino)benzoate tetracaina tetracainum tetracaine 2-(Dimethylamino)ethyl p-(butylamino)benzoate Diaethylaminoaethanol ester der p-butylaminobenzoesaeure Amethocaine p-(butylamino)benzoic acid beta-(dimethylamino)ethyl ester p-Butylaminobenzoyl-2-dimethylaminoethanol |
|
Definitions |
A benzoate ester in which 4-N-butylbenzoic acid and 2-(dimethylamino)ethanol have combined to form the ester bond; a local ester anaesthetic (ester caine) used for surface and spinal anaesthesia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9468 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-4633 PMID:25119673 CAS:94-24-6 PMID:9989796 PMID:7567006 Beilstein:2216051 Patent:US1889645 KEGG:C07526 PMID:7574001 KEGG:D00551 Wikipedia:Tetracaine Drug_Central:2610 Reaxys:2216051 |
|
definition |
A benzoate ester in which 4-N-butylbenzoic acid and 2-(dimethylamino)ethanol have combined to form the ester bond; a local ester anaesthetic (ester caine) used for surface and spinal anaesthesia. |
|
formula |
C15H24N2O2 |
|
has role | ||
has_alternative_id |
CHEBI:132027 |
|
has_exact_synonym |
2-(dimethylamino)ethyl 4-(butylamino)benzoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
tetracaina tetracainum tetracaine 2-(Dimethylamino)ethyl p-(butylamino)benzoate Diaethylaminoaethanol ester der p-butylaminobenzoesaeure Amethocaine p-(butylamino)benzoic acid beta-(dimethylamino)ethyl ester p-Butylaminobenzoyl-2-dimethylaminoethanol |
|
id |
CHEBI:9468 |
|
in_subset | ||
inchi |
InChI=1S/C15H24N2O2/c1-4-5-10-16-14-8-6-13(7-9-14)15(18)19-12-11-17(2)3/h6-9,16H,4-5,10-12H2,1-3H3 |
|
inchikey |
GKCBAIGFKIBETG-UHFFFAOYSA-N |
|
label |
tetracaine |
|
mass |
264.36330 |
|
monoisotopicmass |
264.18378 |
|
notation |
CHEBI:9468 |
|
prefLabel |
tetracaine |
|
smiles |
CCCCNc1ccc(cc1)C(=O)OCCN(C)C |
|
treeView | ||
subClassOf |