loading...| Preferred Name |
sulfamethizole |
|
| Synonyms |
4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide Sulfamethizole sulfamethizolum sulphamethazole sulfamethylthiadiazole sulfamethizol sulfamethizole sulphamethiozole Rufol sulfametizol |
|
| Definitions |
A sulfonamide consisting of a 1,3,4-thiadiazole nucleus with a methyl substituent at C-5 and a 4-aminobenzenesulfonamido group at C-2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9331 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:20303138 PMID:21275251 DrugBank:DB00576 KEGG:C08050 Reaxys:255002 Beilstein:255002 CAS:144-82-1 Wikipedia:Sulfamethizole PMID:17180970 KEGG:D00870 LINCS:LSM-5455 PMID:11431418 Patent:US2447702 Drug_Central:2512 |
|
| definition |
A sulfonamide consisting of a 1,3,4-thiadiazole nucleus with a methyl substituent at C-5 and a 4-aminobenzenesulfonamido group at C-2. |
|
| formula |
C9H10N4O2S2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50502 http://purl.obolibrary.org/obo/CHEBI_35441 |
|
| has_exact_synonym |
4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide Sulfamethizole |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
sulfamethizolum sulphamethazole sulfamethylthiadiazole sulfamethizol sulfamethizole sulphamethiozole Rufol sulfametizol |
|
| id |
CHEBI:9331 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
|
| inchikey |
VACCAVUAMIDAGB-UHFFFAOYSA-N |
|
| label |
sulfamethizole |
|
| mass |
270.33346 |
|
| monoisotopicmass |
270.02452 |
|
| notation |
CHEBI:9331 |
|
| prefLabel |
sulfamethizole |
|
| smiles |
Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35358 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |