Preferred Name |
sulfadoxine |
|
Synonyms |
4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide Sulfadoxine sulfadoxina Sulphormethoxine sulfadoxinum Sulphadoxine Sulforthomidine sulfadoxine 4-Sulfanilamido-5,6-dimethoxypyrimidine |
|
Definitions |
A sulfonamide consisting of pyrimidine having methoxy substituents at the 5- and 6-positions and a 4-aminobenzenesulfonamido group at the 4-position. In combination with the antiprotozoal pyrimethamine (CHEBI:8673) it is used as an antimalarial. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9329 |
|
charge |
0 |
|
database_cross_reference |
PMID:14711594 Drug_Central:2503 DrugBank:DB01299 Wikipedia:Sulfadoxine KEGG:D00580 CAS:2447-57-6 LINCS:LSM-5657 Reaxys:625453 PMID:23183348 KEGG:C07630 PMID:11431418 VSDB:1784 Beilstein:625453 |
|
definition |
A sulfonamide consisting of pyrimidine having methoxy substituents at the 5- and 6-positions and a 4-aminobenzenesulfonamido group at the 4-position. In combination with the antiprotozoal pyrimethamine (CHEBI:8673) it is used as an antimalarial. |
|
formula |
C12H14N4O4S |
|
has role | ||
has_exact_synonym |
4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide Sulfadoxine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
sulfadoxina Sulphormethoxine sulfadoxinum Sulphadoxine Sulforthomidine sulfadoxine 4-Sulfanilamido-5,6-dimethoxypyrimidine |
|
id |
CHEBI:9329 |
|
in_subset | ||
inchi |
InChI=1S/C12H14N4O4S/c1-19-10-11(14-7-15-12(10)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) |
|
inchikey |
PJSFRIWCGOHTNF-UHFFFAOYSA-N |
|
label |
sulfadoxine |
|
mass |
310.33012 |
|
monoisotopicmass |
310.07358 |
|
notation |
CHEBI:9329 |
|
prefLabel |
sulfadoxine |
|
smiles |
COc1ncnc(NS(=O)(=O)c2ccc(N)cc2)c1OC |
|
treeView | ||
subClassOf |