loading...| Preferred Name |
skatole |
|
| Synonyms |
Skatole skatole 3-methyl-1H-indole 3-methyl-4,5-benzopyrrole Skatol beta-methylindole 3-Methylindole |
|
| Definitions |
A methylindole carrying a methyl substituent at position 3. It is produced during the anoxic metabolism of L-tryptophan in the mammalian digestive tract. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9171 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24358366 KEGG:C08313 PMID:16656260 HMDB:HMDB0000466 PMID:7487051 CAS:83-34-1 KNApSAcK:C00001430 Wikipedia:Skatole Beilstein:111296 Reaxys:111296 PMID:22950976 MetaCyc:SKATOLE Gmelin:396961 LINCS:LSM-3655 |
|
| definition |
A methylindole carrying a methyl substituent at position 3. It is produced during the anoxic metabolism of L-tryptophan in the mammalian digestive tract. |
|
| formula |
C9H9N |
|
| has role | ||
| has_exact_synonym |
Skatole skatole 3-methyl-1H-indole |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-methyl-4,5-benzopyrrole Skatol beta-methylindole 3-Methylindole |
|
| id |
CHEBI:9171 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3 |
|
| inchikey |
ZFRKQXVRDFCRJG-UHFFFAOYSA-N |
|
| label |
skatole |
|
| mass |
131.17450 |
|
| monoisotopicmass |
131.07350 |
|
| notation |
CHEBI:9171 |
|
| prefLabel |
skatole |
|
| smiles |
Cc1c[nH]c2ccccc12 |
|
| treeView | ||
| subClassOf |