Preferred Name |
rivastigmine |
|
Synonyms |
3-[(1S)-1-(dimethylamino)ethyl]phenyl ethyl(methyl)carbamate rivastigmine m-((S)-1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate (S)-3-(1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate |
|
Definitions |
A carbamate ester obtained by formal condensation of the carboxy group of ethyl(methyl)carbamic acid with the phenolic OH group of 3-[(1S)-1-(dimethylamino)ethyl]phenol. A reversible cholinesterase inhibitor. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8874 |
|
charge |
0 |
|
database_cross_reference |
PMID:22173266 KEGG:D03822 PMID:19370562 PMID:19032006 PMID:21996001 LINCS:LSM-5280 PMID:22409834 PMID:21131668 PMID:22230648 PMID:22009228 Patent:US2009298817 PMID:22290743 Reaxys:7875788 PMID:22163243 PMID:21246897 PMID:22163242 PMID:19893314 PMID:22044027 PMID:22054233 PMID:20370805 PMID:19619073 PMID:21977379 KEGG:C11766 PMID:22224039 Drug_Central:2392 PMID:22451057 PMID:22010358 Patent:DE3805744 DrugBank:DB00989 PMID:20865460 PMID:22195801 Patent:EP1980552 PMID:22068922 PMID:19392927 PMID:20070789 PMID:22230878 Wikipedia:Rivastigmine PMID:22163241 PMID:22362231 PMID:22087207 Patent:US2008255383 CAS:123441-03-2 Patent:EP2233465 Patent:US5602176 |
|
definition |
A carbamate ester obtained by formal condensation of the carboxy group of ethyl(methyl)carbamic acid with the phenolic OH group of 3-[(1S)-1-(dimethylamino)ethyl]phenol. A reversible cholinesterase inhibitor. |
|
formula |
C14H22N2O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_38323 |
|
has_exact_synonym |
3-[(1S)-1-(dimethylamino)ethyl]phenyl ethyl(methyl)carbamate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
rivastigmine m-((S)-1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate (S)-3-(1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate |
|
id |
CHEBI:8874 |
|
in_subset | ||
inchi |
InChI=1S/C14H22N2O2/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4/h7-11H,6H2,1-5H3/t11-/m0/s1 |
|
inchikey |
XSVMFMHYUFZWBK-NSHDSACASA-N |
|
is conjugate base of | ||
label |
rivastigmine |
|
mass |
250.33670 |
|
monoisotopicmass |
250.16813 |
|
notation |
CHEBI:8874 |
|
prefLabel |
rivastigmine |
|
smiles |
CCN(C)C(=O)Oc1cccc(c1)[C@H](C)N(C)C |
|
treeView | ||
subClassOf |