loading...| Preferred Name |
quinethazone |
|
| Synonyms |
7-chloro-2-ethyl-4-oxo-1,2,3,4-tetrahydroquinazoline-6-sulfonamide 7-chloro-2-ethyl-1,2,3,4-tetrahydro-4-oxo-6-quinazolinesulfonamide |
|
| Definitions |
A member of the class of quinazolines that is quinazolin-4-one substituted at positions 2, 6 and 7 by ethyl, sulfamoyl and chloro groups respectively; a thiazide-like diuretic used to treat hypertension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8717 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:818554 PMID:14066683 CAS:73-49-4 PMID:28166217 PMID:13953345 KEGG:C07342 LINCS:LSM-1666 PMID:14085918 PMID:14160213 Patent:US9393221 PMID:4896145 KEGG:D00461 |
|
| definition |
A member of the class of quinazolines that is quinazolin-4-one substituted at positions 2, 6 and 7 by ethyl, sulfamoyl and chloro groups respectively; a thiazide-like diuretic used to treat hypertension. |
|
| formula |
C10H12ClN3O3S |
|
| has role | ||
| has_exact_synonym |
7-chloro-2-ethyl-4-oxo-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
7-chloro-2-ethyl-1,2,3,4-tetrahydro-4-oxo-6-quinazolinesulfonamide |
|
| id |
CHEBI:8717 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H12ClN3O3S/c1-2-9-13-7-4-6(11)8(18(12,16)17)3-5(7)10(15)14-9/h3-4,9,13H,2H2,1H3,(H,14,15)(H2,12,16,17) |
|
| inchikey |
AGMMTXLNIQSRCG-UHFFFAOYSA-N |
|
| label |
quinethazone |
|
| mass |
289.740 |
|
| monoisotopicmass |
289.02879 |
|
| notation |
CHEBI:8717 |
|
| prefLabel |
quinethazone |
|
| smiles |
C12=C(C=C(S(N)(=O)=O)C(=C1)Cl)C(NC(N2)CC)=O |
|
| treeView | ||
| subClassOf |