Preferred Name |
pyrimethamine |
|
Synonyms |
5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine Ethylpyrimidine CD 5-(4-Chlorophenyl)-6-ethyl-2,4-diaminopyrimidine 2,4-Diamino-5-(p-chlorophenyl)-6-ethylpyrimidine pirimetamina Chloridyn pyrimethamine pyrimethaminum Chloridine 5-(4'-Chlorophenyl)-2,4-diamino-6-ethylpyrimidine 2,4-Diamino-5-(4-chlorophenyl)-6-ethylpyrimidine Diaminopyritamin 5-(4-Chlorophenyl)-6-ethyl-2,4-pyrimidinediamine 2,4-Diamino-5-chlorophenyl-6-ethylpyrimidine Primethamine |
|
Definitions |
An aminopyrimidine that is pyrimidine-2,4-diamine which is substituted at position 5 by a p-chlorophenyl group and at position 6 by an ethyl group. It is a folic acid antagonist used as an antimalarial or with a sulfonamide to treat toxoplasmosis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8673 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00205 PMID:19435820 PDBeChem:CP6 PMID:28166217 LINCS:LSM-3967 PMID:11313656 KEGG:C07391 PMID:11257045 Wikipedia:Pyrimethamine Beilstein:219864 KEGG:D00488 Reaxys:219864 HMDB:HMDB0014350 VSDB:1912 PMID:3377143 PMID:12543697 CAS:58-14-0 PMID:16157660 |
|
definition |
An aminopyrimidine that is pyrimidine-2,4-diamine which is substituted at position 5 by a p-chlorophenyl group and at position 6 by an ethyl group. It is a folic acid antagonist used as an antimalarial or with a sulfonamide to treat toxoplasmosis. |
|
formula |
C12H13ClN4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50683 |
|
has_exact_synonym |
5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Ethylpyrimidine CD 5-(4-Chlorophenyl)-6-ethyl-2,4-diaminopyrimidine 2,4-Diamino-5-(p-chlorophenyl)-6-ethylpyrimidine pirimetamina Chloridyn pyrimethamine pyrimethaminum Chloridine 5-(4'-Chlorophenyl)-2,4-diamino-6-ethylpyrimidine 2,4-Diamino-5-(4-chlorophenyl)-6-ethylpyrimidine Diaminopyritamin 5-(4-Chlorophenyl)-6-ethyl-2,4-pyrimidinediamine 2,4-Diamino-5-chlorophenyl-6-ethylpyrimidine Primethamine |
|
id |
CHEBI:8673 |
|
in_subset | ||
inchi |
InChI=1S/C12H13ClN4/c1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H4,14,15,16,17) |
|
inchikey |
WKSAUQYGYAYLPV-UHFFFAOYSA-N |
|
label |
pyrimethamine |
|
mass |
248.71100 |
|
monoisotopicmass |
248.08287 |
|
notation |
CHEBI:8673 |
|
prefLabel |
pyrimethamine |
|
smiles |
CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1 |
|
treeView | ||
subClassOf |