loading...| Preferred Name |
proguanil |
|
| Synonyms |
N-(4-chlorophenyl)-N'-(propan-2-yl)imidodicarbonimidic diamide Chloroguanide 1-(p-chlorophenyl)-5-isopropylbiguanide N-(4-Chlorophenyl)-N'-(isopropyl)-imidodicarbonimidic diamide proguanil proguanilum Chlorguanide |
|
| Definitions |
A biguanide compound which has isopropyl and p-chlorophenyl substituents on the terminal N atoms. A prophylactic antimalarial drug, it works by inhibiting the enzyme dihydrofolate reductase, which is involved in the reproduction of the malaria parasites Plasmodium falciparum and P. vivax within the red blood cells. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8455 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Proguanil DrugBank:DB01131 HMDB:HMDB0015263 PMID:15504827 KEGG:D08428 Drug_Central:2282 KEGG:C07631 LINCS:LSM-2618 PMID:8866915 CAS:500-92-5 PMID:10348748 Reaxys:2811599 Beilstein:2811599 PMID:10848923 |
|
| definition |
A biguanide compound which has isopropyl and p-chlorophenyl substituents on the terminal N atoms. A prophylactic antimalarial drug, it works by inhibiting the enzyme dihydrofolate reductase, which is involved in the reproduction of the malaria parasites Plasmodium falciparum and P. vivax within the red blood cells. |
|
| formula |
C11H16ClN5 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50683 |
|
| has_exact_synonym |
N-(4-chlorophenyl)-N'-(propan-2-yl)imidodicarbonimidic diamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Chloroguanide 1-(p-chlorophenyl)-5-isopropylbiguanide N-(4-Chlorophenyl)-N'-(isopropyl)-imidodicarbonimidic diamide proguanil proguanilum Chlorguanide |
|
| id |
CHEBI:8455 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H16ClN5/c1-7(2)15-10(13)17-11(14)16-9-5-3-8(12)4-6-9/h3-7H,1-2H3,(H5,13,14,15,16,17) |
|
| inchikey |
SSOLNOMRVKKSON-UHFFFAOYSA-N |
|
| label |
proguanil |
|
| mass |
253.73100 |
|
| monoisotopicmass |
253.10942 |
|
| notation |
CHEBI:8455 |
|
| prefLabel |
proguanil |
|
| smiles |
CC(C)NC(=N)NC(=N)Nc1ccc(Cl)cc1 |
|
| treeView | ||
| subClassOf |