Preferred Name |
phencyclidine |
|
Synonyms |
1-(1-phenylcyclohexyl)piperidine Phencyclidine fenciclidina PCP phencyclidine phencyclidinum |
|
Definitions |
A member of the class of piperidines that is piperidine in which the nitrogen is substituted with a 1-phenylcyclohexyl group. Formerly used as an anaesthetic agent, it exhibits both hallucinogenic and neurotoxic effects. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8058 |
|
charge |
0 |
|
database_cross_reference |
CAS:77-10-1 PDBeChem:1PC Drug_Central:2121 Wikipedia:Phencyclidine KEGG:C07575 PMID:10379517 PMID:9007505 PMID:7250199 DrugBank:DB03575 PMID:10696810 PMID:12206280 PMID:9786848 PMID:8855512 PMID:17265073 Reaxys:20976544 PMID:22467667 PMID:7968937 PMID:8103992 |
|
definition |
A member of the class of piperidines that is piperidine in which the nitrogen is substituted with a 1-phenylcyclohexyl group. Formerly used as an anaesthetic agent, it exhibits both hallucinogenic and neurotoxic effects. |
|
formula |
C17H25N |
|
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35471 http://purl.obolibrary.org/obo/CHEBI_38867 |
|
has_exact_synonym |
1-(1-phenylcyclohexyl)piperidine Phencyclidine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
fenciclidina PCP phencyclidine phencyclidinum |
|
id |
CHEBI:8058 |
|
in_subset | ||
inchi |
InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2 |
|
inchikey |
JTJMJGYZQZDUJJ-UHFFFAOYSA-N |
|
label |
phencyclidine |
|
mass |
243.38710 |
|
monoisotopicmass |
243.19870 |
|
notation |
CHEBI:8058 |
|
prefLabel |
phencyclidine |
|
smiles |
C1CCN(CC1)C1(CCCCC1)c1ccccc1 |
|
treeView | ||
subClassOf |