Preferred Name |
oxazepam |
|
Synonyms |
Oxazepam 7-chloro-3-hydroxy-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one Tazepam Serax (RS)-Oxazepam (+-)-Oxazepam |
|
Definitions |
A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a chloro group at position 7, a hydroxy group at position 3 and phenyl group at position 5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7823 |
|
charge |
0 |
|
database_cross_reference |
PMID:9811432 Patent:CN1543961 Wikipedia:Oxazepam DrugBank:DB00842 KEGG:D00464 Reaxys:754065 CAS:604-75-1 Drug_Central:2015 KEGG:C07359 HMDB:HMDB0014980 PMID:17456431 |
|
definition |
A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a chloro group at position 7, a hydroxy group at position 3 and phenyl group at position 5. |
|
formula |
C15H11ClN2O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35474 |
|
has_exact_synonym |
Oxazepam 7-chloro-3-hydroxy-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Tazepam Serax (RS)-Oxazepam (+-)-Oxazepam |
|
id |
CHEBI:7823 |
|
in_subset | ||
inchi |
InChI=1S/C15H11ClN2O2/c16-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)18-15(20)14(19)17-12/h1-8,15,20H,(H,17,19) |
|
inchikey |
ADIMAYPTOBDMTL-UHFFFAOYSA-N |
|
label |
oxazepam |
|
mass |
286.71300 |
|
monoisotopicmass |
286.05091 |
|
notation |
CHEBI:7823 |
|
prefLabel |
oxazepam |
|
smiles |
OC1N=C(c2ccccc2)c2cc(Cl)ccc2NC1=O |
|
treeView | ||
subClassOf |