loading...| Preferred Name |
oxaprozin |
|
| Synonyms |
3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid oxaprozine Deflam oxaprozina Danoprox Dayrun Walix Daypro oxaprozin oxaprozinum Duraprox |
|
| Definitions |
A monocarboxylic acid that is a propionic acid derivative having a 4,5-diphenyl-1,3-oxazol-2-yl substituent at position 3. It is non-steroidal anti-inflammatory drug commonly used to relieve the pain and inflammatory responses associated with osteoarthritis and rheumatoid arthritis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7822 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:9459947 PMID:19338579 Reaxys:1083168 Patent:US3578671 PMID:6611288 Wikipedia:Oxaprozin PMID:1603605 DrugBank:DB00991 CAS:21256-18-8 KEGG:D00463 PMID:6432657 HMDB:HMDB0015126 Patent:FR2001036 PMID:19672323 PMID:23865335 PMID:1617910 KEGG:C07356 LINCS:LSM-2553 PMID:6863578 PMID:20206429 PMID:385873 Patent:GB1206403 Patent:WO2007082542 Drug_Central:2013 |
|
| definition |
A monocarboxylic acid that is a propionic acid derivative having a 4,5-diphenyl-1,3-oxazol-2-yl substituent at position 3. It is non-steroidal anti-inflammatory drug commonly used to relieve the pain and inflammatory responses associated with osteoarthritis and rheumatoid arthritis. |
|
| formula |
C18H15NO3 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
oxaprozine Deflam oxaprozina Danoprox Dayrun Walix Daypro oxaprozin oxaprozinum Duraprox |
|
| id |
CHEBI:7822 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21) |
|
| inchikey |
OFPXSFXSNFPTHF-UHFFFAOYSA-N |
|
| label |
oxaprozin |
|
| mass |
293.31660 |
|
| monoisotopicmass |
293.10519 |
|
| notation |
CHEBI:7822 |
|
| prefLabel |
oxaprozin |
|
| smiles |
OC(=O)CCc1nc(-c2ccccc2)c(o1)-c1ccccc1 |
|
| treeView | ||
| subClassOf |