loading...| Preferred Name |
potassium sorbate |
|
| Synonyms |
potassium (2E,4E)-hexa-2,4-dienoate Potassium (E,E)-sorbate potassium trans,trans-sorbate Potassium (E,E)-2,4-hexadienoate potassium trans,trans-2,4-hexadienoate |
|
| Definitions |
A potassium salt having sorbate as the counterion. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_77868 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22985004 Wikipedia:Potassium_sorbate PMID:23790859 PMID:23498172 KEGG:D02411 CAS:24634-61-5 Reaxys:5357554 PMID:24001567 |
|
| definition |
A potassium salt having sorbate as the counterion. |
|
| formula |
C6H7KO2 |
|
| has part | ||
| has role | ||
| has_exact_synonym |
potassium (2E,4E)-hexa-2,4-dienoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Potassium (E,E)-sorbate potassium trans,trans-sorbate Potassium (E,E)-2,4-hexadienoate potassium trans,trans-2,4-hexadienoate |
|
| id |
CHEBI:77868 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H8O2.K/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+; |
|
| inchikey |
CHHHXKFHOYLYRE-STWYSWDKSA-M |
|
| label |
potassium sorbate |
|
| mass |
150.21690 |
|
| monoisotopicmass |
150.00831 |
|
| notation |
CHEBI:77868 |
|
| prefLabel |
potassium sorbate |
|
| smiles |
[K+].C\C=C\C=C\C([O-])=O |
|
| treeView | ||
| subClassOf |