loading...| Preferred Name |
olsalazine |
|
| Synonyms |
Olsalazine 3,3'-diazene-1,2-diylbis(6-hydroxybenzoic acid) olsalazine 3,3'-Azobis(6-hydroxybenzoic acid) 5,5'-Azobis(salicylic acid) Olsalazina Olsalazinum |
|
| Definitions |
An azobenzene that consists of two molecules of 4-aminosalicylic acid joined by an azo linkage. A prodrug for mesalazine, an anti-inflammatory drug, it is used (as the disodium salt) in the treatment of inflammatory bowel disease. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7770 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:EP36636 CAS:15722-48-2 DrugBank:DB01250 KEGG:D08295 Wikipedia:Olsalazine Patent:US1157169 Patent:US4528367 Reaxys:3218651 Patent:DE278613 KEGG:C07323 Drug_Central:1988 |
|
| definition |
An azobenzene that consists of two molecules of 4-aminosalicylic acid joined by an azo linkage. A prodrug for mesalazine, an anti-inflammatory drug, it is used (as the disodium salt) in the treatment of inflammatory bowel disease. |
|
| formula |
C14H10N2O6 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
Olsalazine 3,3'-diazene-1,2-diylbis(6-hydroxybenzoic acid) |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
olsalazine 3,3'-Azobis(6-hydroxybenzoic acid) 5,5'-Azobis(salicylic acid) Olsalazina Olsalazinum |
|
| id |
CHEBI:7770 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22) |
|
| inchikey |
QQBDLJCYGRGAKP-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
olsalazine |
|
| mass |
302.23900 |
|
| monoisotopicmass |
302.05389 |
|
| notation |
CHEBI:7770 |
|
| prefLabel |
olsalazine |
|
| smiles |
OC(=O)c1cc(ccc1O)N=Nc1ccc(O)c(c1)C(O)=O |
|
| treeView | ||
| subClassOf |