Preferred Name |
armodafinil |
|
Synonyms |
2-[(R)-(diphenylmethyl)sulfinyl]acetamide (R)-modafinil (-)-(R)-modafinil (R)-(-)-modafinil armodafinil CEP-10953 (-)-modafinil armodafinilo Nuvigil CEP 10953 armodafinilum |
|
Definitions |
A 2-[(diphenylmethyl)sulfinyl]acetamide that has R configuration at the sulfur atom. Like its racemate, modafinil, it is used for the treatment of sleeping disorders such as narcolepsy, obstructive sleep apnoea, and shift-work sleep disorder. Peak concentration in the blood later occurs later following administration than with modafinil, so it is thought that armodafinil may be more effective than modafinil in treating people with excessive daytime sleepiness. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_77590 |
|
charge |
0 |
|
database_cross_reference |
PMID:21427431 Reaxys:9767970 PMID:22967783 PMID:22803602 PMID:22128728 PMID:24122734 Wikipedia:Armodafinil Drug_Central:4501 PMID:22210169 PMID:22960434 PMID:22039290 PMID:22537794 PMID:23251870 PMID:20697340 PMID:20816042 PMID:19689169 PMID:19663523 CAS:112111-43-0 PMID:23983964 KEGG:D03215 PMID:22917711 |
|
definition |
A 2-[(diphenylmethyl)sulfinyl]acetamide that has R configuration at the sulfur atom. Like its racemate, modafinil, it is used for the treatment of sleeping disorders such as narcolepsy, obstructive sleep apnoea, and shift-work sleep disorder. Peak concentration in the blood later occurs later following administration than with modafinil, so it is thought that armodafinil may be more effective than modafinil in treating people with excessive daytime sleepiness. |
|
formula |
C15H15NO2S |
|
has role | ||
has_exact_synonym |
2-[(R)-(diphenylmethyl)sulfinyl]acetamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(R)-modafinil (-)-(R)-modafinil (R)-(-)-modafinil armodafinil CEP-10953 (-)-modafinil armodafinilo Nuvigil CEP 10953 armodafinilum |
|
id |
CHEBI:77590 |
|
in_subset | ||
inchi |
InChI=1S/C15H15NO2S/c16-14(17)11-19(18)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,16,17)/t19-/m1/s1 |
|
inchikey |
YFGHCGITMMYXAQ-LJQANCHMSA-N |
|
is enantiomer of | ||
label |
armodafinil |
|
mass |
273.35000 |
|
monoisotopicmass |
273.08235 |
|
notation |
CHEBI:77590 |
|
prefLabel |
armodafinil |
|
smiles |
NC(=O)C[S@@](=O)C(c1ccccc1)c1ccccc1 |
|
treeView | ||
subClassOf |