Preferred Name |
flecainide |
|
Synonyms |
N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide CCRIS 313 flecainidum flecainida (+-)-flecainide Flecaine N-(2-Piperidinylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide flecainide |
|
Definitions |
A monocarboxylic acid amide obtained by formal condensation of the carboxy group of 2,5-bis(2,2,2-trifluoroethoxy)benzoic acid with the primary amino group of piperidin-2-ylmethylamine. An antiarrhythmic agent used (in the form of its acetate salt) to prevent and treat tachyarrhythmia (abnormal fast rhythm of the heart). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_75984 |
|
charge |
0 |
|
database_cross_reference |
PMID:24084224 PMID:24019076 PMID:22981658 Reaxys:500093 KEGG:C07001 PMID:23334259 PMID:23286974 PMID:23410160 PMID:21029131 PMID:22882363 DrugBank:DB01195 PMID:23954267 PMID:23700986 PMID:23635804 Drug_Central:1176 PMID:23518212 Wikipedia:Flecainide PMID:23202797 KEGG:D07962 LINCS:LSM-1297 PMID:23558880 PMID:23756405 PMID:23188129 PMID:22526215 PMID:23647896 HMDB:HMDB0015326 PMID:23714084 PMID:23329876 PMID:23067130 PMID:22913299 CAS:54143-55-4 |
|
definition |
A monocarboxylic acid amide obtained by formal condensation of the carboxy group of 2,5-bis(2,2,2-trifluoroethoxy)benzoic acid with the primary amino group of piperidin-2-ylmethylamine. An antiarrhythmic agent used (in the form of its acetate salt) to prevent and treat tachyarrhythmia (abnormal fast rhythm of the heart). |
|
formula |
C17H20F6N2O3 |
|
has role | ||
has_alternative_id |
CHEBI:5090 |
|
has_exact_synonym |
N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
CCRIS 313 flecainidum flecainida (+-)-flecainide Flecaine N-(2-Piperidinylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide flecainide |
|
id |
CHEBI:75984 |
|
in_subset | ||
inchi |
InChI=1S/C17H20F6N2O3/c18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11/h4-5,7,11,24H,1-3,6,8-10H2,(H,25,26) |
|
inchikey |
DJBNUMBKLMJRSA-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
flecainide |
|
mass |
414.34270 |
|
monoisotopicmass |
414.13781 |
|
notation |
CHEBI:75984 |
|
prefLabel |
flecainide |
|
smiles |
FC(F)(F)COc1ccc(OCC(F)(F)F)c(c1)C(=O)NCC1CCCCN1 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_37143 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_37143 |