loading...| Preferred Name |
nabumetone |
|
| Synonyms |
nabumetona nabumetone 4-(6-Methoxy-2-naphthyl)-2-butanone nabumetonum 4-(6-Methoxy-2-naphthalenyl)-2-butanone Relafen |
|
| Definitions |
A methyl ketone that is 2-butanone in which one of the methyl hydrogens at position 4 is replaced by a 6-methoxy-2-naphthyl group. A prodrug that is converted to the active metabolite, 6-methoxy-2-naphthylacetic acid, following oral administration. It is shown to have a slightly lower risk of gastrointestinal side effects than most other non-steroidal anti-inflammatory drugs. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7443 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22298755 PMID:22381180 PMID:23225308 PMID:23132511 PDBeChem:NBO PMID:23129452 PMID:23781467 PMID:23584048 PMID:24083957 PMID:23020786 Beilstein:2103472 PMID:22605805 HMDB:HMDB0014604 PMID:24074034 PMID:21532165 PMID:21650014 PMID:22977877 CAS:42924-53-8 LINCS:LSM-3453 Reaxys:2103472 DrugBank:DB00461 Wikipedia:Nabumetone PMID:23781476 PMID:22028826 PMID:21898684 KEGG:D00425 PMID:23806470 PMID:21674107 Drug_Central:1863 |
|
| definition |
A methyl ketone that is 2-butanone in which one of the methyl hydrogens at position 4 is replaced by a 6-methoxy-2-naphthyl group. A prodrug that is converted to the active metabolite, 6-methoxy-2-naphthylacetic acid, following oral administration. It is shown to have a slightly lower risk of gastrointestinal side effects than most other non-steroidal anti-inflammatory drugs. |
|
| formula |
C15H16O2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
nabumetona nabumetone 4-(6-Methoxy-2-naphthyl)-2-butanone nabumetonum 4-(6-Methoxy-2-naphthalenyl)-2-butanone Relafen |
|
| id |
CHEBI:7443 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H16O2/c1-11(16)3-4-12-5-6-14-10-15(17-2)8-7-13(14)9-12/h5-10H,3-4H2,1-2H3 |
|
| inchikey |
BLXXJMDCKKHMKV-UHFFFAOYSA-N |
|
| label |
nabumetone |
|
| mass |
228.28630 |
|
| monoisotopicmass |
228.11503 |
|
| notation |
CHEBI:7443 |
|
| prefLabel |
nabumetone |
|
| smiles |
COc1ccc2cc(CCC(C)=O)ccc2c1 |
|
| treeView | ||
| subClassOf |