loading...| Preferred Name |
azilsartan |
|
| Synonyms |
2-ethoxy-1-{[2'-(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylic acid TAK 536 TAK-536 azilsartan |
|
| Definitions |
A benzimidazolecarboxylic acid that is benzimidazole-7-carboxylic acid substituted at position 2 by a methoxy group and at position 1 by a 2'-[(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methyl group. Used (as the prodrug, azilsartan medoxomil) for treatment of hypertension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_68850 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:EP1787647 PMID:21983318 Wikipedia:Azilsartan Reaxys:7673311 PMID:22399858 PMID:22745562 Patent:US2005187269 Patent:WO2012107814 PMID:21749604 PMID:22728984 CAS:147403-03-0 PMID:23034464 PMID:21986624 PMID:22365278 KEGG:D08864 PMID:23012812 PMID:23051655 PMID:22278628 PMID:22975662 PMID:22661897 |
|
| definition |
A benzimidazolecarboxylic acid that is benzimidazole-7-carboxylic acid substituted at position 2 by a methoxy group and at position 1 by a 2'-[(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methyl group. Used (as the prodrug, azilsartan medoxomil) for treatment of hypertension. |
|
| formula |
C25H20N4O5 |
|
| has role | ||
| has_exact_synonym |
2-ethoxy-1-{[2'-(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
TAK 536 TAK-536 azilsartan |
|
| id |
CHEBI:68850 |
|
| in_subset | ||
| inchi |
InChI=1S/C25H20N4O5/c1-2-33-24-26-20-9-5-8-19(23(30)31)21(20)29(24)14-15-10-12-16(13-11-15)17-6-3-4-7-18(17)22-27-25(32)34-28-22/h3-13H,2,14H2,1H3,(H,30,31)(H,27,28,32) |
|
| inchikey |
KGSXMPPBFPAXLY-UHFFFAOYSA-N |
|
| label |
azilsartan |
|
| mass |
456.45010 |
|
| monoisotopicmass |
456.14337 |
|
| notation |
CHEBI:68850 |
|
| prefLabel |
azilsartan |
|
| smiles |
CCOc1nc2cccc(C(O)=O)c2n1Cc1ccc(cc1)-c1ccccc1-c1noc(=O)[nH]1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |