loading...| Preferred Name |
methaqualone |
|
| Synonyms |
2-methyl-3-(2-methylphenyl)quinazolin-4(3H)-one methaqualonum metacualona methaqualone |
|
| Definitions |
A member of the class of quinazolines that is quinazolin-4-one substituted at positions 2 and 3 by methyl and o-tolyl groups respectively. A depressant that increases the activity of the GABA receptors in the brain and nervous system, it is used as a sedative and hypnotic medication. It became popular as a recreational drug and club drug in the late 1960s and 1970s. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6821 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:16861151 PMID:28166217 PMID:3397524 PMID:16566774 PMID:15846700 PMID:11672968 CAS:72-44-6 PMID:2701316 PMID:26056160 PMID:22019312 |
|
| definition |
A member of the class of quinazolines that is quinazolin-4-one substituted at positions 2 and 3 by methyl and o-tolyl groups respectively. A depressant that increases the activity of the GABA receptors in the brain and nervous system, it is used as a sedative and hypnotic medication. It became popular as a recreational drug and club drug in the late 1960s and 1970s. |
|
| formula |
C16H14N2O |
|
| has role | ||
| has_exact_synonym |
2-methyl-3-(2-methylphenyl)quinazolin-4(3H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
methaqualonum metacualona methaqualone |
|
| id |
CHEBI:6821 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H14N2O/c1-11-7-3-6-10-15(11)18-12(2)17-14-9-5-4-8-13(14)16(18)19/h3-10H,1-2H3 |
|
| inchikey |
JEYCTXHKTXCGPB-UHFFFAOYSA-N |
|
| label |
methaqualone |
|
| mass |
250.296 |
|
| monoisotopicmass |
250.11061 |
|
| notation |
CHEBI:6821 |
|
| prefLabel |
methaqualone |
|
| smiles |
N1(C=2C(=CC=CC2)C)C(C3=C(C=CC=C3)N=C1C)=O |
|
| treeView | ||
| subClassOf |