Preferred Name |
metaraminol |
|
Synonyms |
Metaraminol 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol M-Hydroxyphenylpropanolamine M-Hydroxy Norephedrine L-Metaraminol alpha-(1-Aminoethyl)-3-hydroxybenzenemethanol metaraminol 3-Hydroxyphenylisopropanolamine Hydroxynorephedrine alpha-(m-Hydroxyphenyl)-beta-aminopropanol 1-Metaraminol m-Hydroxypropadrine (-)-Erythro-metaraminol metaraminolum 1-(m-Hydroxyphenyl)-2-amino-1-propanol 2-Amino-1-(m-hydroxyphenyl)-1-propanol |
|
Definitions |
A member of the class of phenylethanolamines that is 2-amino-1-phenylethanol substituted by a methyl group at position 2 and a phenolic hydroxy group at position 1. A sympathomimetic agent , it is used in the treatment of hypotension. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6794 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00610 CAS:54-49-9 Patent:US1951302 Patent:CH162367 Wikipedia:Metaraminol KEGG:C07146 Patent:GB396951 PMID:21629799 Beilstein:3198820 Patent:GB353361 Drug_Central:1721 Reaxys:3198820 KEGG:D08192 LINCS:LSM-6000 HMDB:HMDB0014748 PMID:14163327 Patent:US1948162 Patent:US1995709 |
|
definition |
A member of the class of phenylethanolamines that is 2-amino-1-phenylethanol substituted by a methyl group at position 2 and a phenolic hydroxy group at position 1. A sympathomimetic agent , it is used in the treatment of hypotension. |
|
formula |
C9H13NO2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35524 |
|
has_exact_synonym |
Metaraminol 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
M-Hydroxyphenylpropanolamine M-Hydroxy Norephedrine L-Metaraminol alpha-(1-Aminoethyl)-3-hydroxybenzenemethanol metaraminol 3-Hydroxyphenylisopropanolamine Hydroxynorephedrine alpha-(m-Hydroxyphenyl)-beta-aminopropanol 1-Metaraminol m-Hydroxypropadrine (-)-Erythro-metaraminol metaraminolum 1-(m-Hydroxyphenyl)-2-amino-1-propanol 2-Amino-1-(m-hydroxyphenyl)-1-propanol |
|
id |
CHEBI:6794 |
|
in_subset | ||
inchi |
InChI=1S/C9H13NO2/c1-6(10)9(12)7-3-2-4-8(11)5-7/h2-6,9,11-12H,10H2,1H3/t6-,9-/m0/s1 |
|
inchikey |
WXFIGDLSSYIKKV-RCOVLWMOSA-N |
|
label |
metaraminol |
|
mass |
167.20506 |
|
monoisotopicmass |
167.09463 |
|
notation |
CHEBI:6794 |
|
prefLabel |
metaraminol |
|
smiles |
C[C@H](N)[C@H](O)c1cccc(O)c1 |
|
treeView | ||
subClassOf |