loading...| Preferred Name |
mesoridazine |
|
| Synonyms |
10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfinyl)-10H-phenothiazine Mesoridazine 10-(2(1-Methyl-2-piperidyl)ethyl)-2-(methylsulfinyl)phenothiazine 10-(2-(1-Methyl-2-piperidyl)ethyl)-2-methylsulfinyl phenothiazine mesoridazina TPS-23 mesoridazinum thioridazine thiomethyl sulfoxide 2-Methanesulfinyl-10-[2-(1-methyl-piperidin-2-yl)-ethyl]-10H-phenothiazine thioridazine-2-sulfoxide mesoridazine |
|
| Definitions |
A phenothiazine substituted at position 2 (para to the S atom) by a methylsulfinyl group, and on the nitrogen by a 2-(1-methylpiperidin-2-yl)ethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6780 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:1033986 KEGG:D02671 Patent:US3084161 DrugBank:DB00933 LINCS:LSM-1329 CAS:5588-33-0 KEGG:C07143 Drug_Central:1712 Wikipedia:Mesoridazine |
|
| definition |
A phenothiazine substituted at position 2 (para to the S atom) by a methylsulfinyl group, and on the nitrogen by a 2-(1-methylpiperidin-2-yl)ethyl group. |
|
| formula |
C21H26N2OS2 |
|
| has role | ||
| has_alternative_id |
CHEBI:248004 |
|
| has_exact_synonym |
10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfinyl)-10H-phenothiazine Mesoridazine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
10-(2(1-Methyl-2-piperidyl)ethyl)-2-(methylsulfinyl)phenothiazine 10-(2-(1-Methyl-2-piperidyl)ethyl)-2-methylsulfinyl phenothiazine mesoridazina TPS-23 mesoridazinum thioridazine thiomethyl sulfoxide 2-Methanesulfinyl-10-[2-(1-methyl-piperidin-2-yl)-ethyl]-10H-phenothiazine thioridazine-2-sulfoxide mesoridazine |
|
| id |
CHEBI:6780 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
|
| inchikey |
SLVMESMUVMCQIY-UHFFFAOYSA-N |
|
| label |
mesoridazine |
|
| mass |
386.57400 |
|
| monoisotopicmass |
386.14866 |
|
| notation |
CHEBI:6780 |
|
| prefLabel |
mesoridazine |
|
| smiles |
CN1CCCCC1CCN1c2ccccc2Sc2ccc(cc12)S(C)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_22063 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22063 |