loading...| Preferred Name |
pethidine |
|
| Synonyms |
ethyl 1-methyl-4-phenylpiperidine-4-carboxylate pethidin pethidine ethyl 1-methyl-4-phenylisonipecotate N-methyl-4-phenyl-4-carbethoxypiperidine petydyna pethidinum pethidineter phetidine 1-methyl-4-phenylisonipecotic acid ethyl ester 1-methyl-4-phenylpiperidine-4-carboxylic acid ethyl ester meperidine Meperidol methyl phenylpiperidine carbonic acid ethyl ester Nemerol 1-methyl-4-phenyl-4-piperidinecarboxylic acid ethyl ester meperidina isonipecaine petidina Pethanol IDS-NP-001 Demerol |
|
| Definitions |
A piperidinecarboxylate ester that is piperidine which is substituted by a methyl group at position 1 and by phenyl and ethoxycarbonyl groups at position 4. It is an analgesic which is used for the treatment of moderate to severe pain, including postoperative pain and labour pain. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6754 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:1690 Wikipedia:Pethidine PMID:32214301 PMID:31874879 PMID:30786304 PMID:30902579 PMID:31633090 HMDB:HMDB0014597 KEGG:C07128 PMID:31486253 PMID:30487674 PMID:30115484 PMID:30902024 PMID:31001434 PMID:30386603 PMID:31319637 PMID:30418234 PMID:27621675 PMID:31294134 PMID:29880084 PMID:32001961 KEGG:D08343 DrugBank:DB00454 CAS:57-42-1 PMID:31423145 PMID:28666300 PMID:30362203 |
|
| definition |
A piperidinecarboxylate ester that is piperidine which is substituted by a methyl group at position 1 and by phenyl and ethoxycarbonyl groups at position 4. It is an analgesic which is used for the treatment of moderate to severe pain, including postoperative pain and labour pain. |
|
| formula |
C15H21NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_53784 http://purl.obolibrary.org/obo/CHEBI_55322 |
|
| has_exact_synonym |
ethyl 1-methyl-4-phenylpiperidine-4-carboxylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pethidin pethidine ethyl 1-methyl-4-phenylisonipecotate N-methyl-4-phenyl-4-carbethoxypiperidine petydyna pethidinum pethidineter phetidine 1-methyl-4-phenylisonipecotic acid ethyl ester 1-methyl-4-phenylpiperidine-4-carboxylic acid ethyl ester meperidine Meperidol methyl phenylpiperidine carbonic acid ethyl ester Nemerol 1-methyl-4-phenyl-4-piperidinecarboxylic acid ethyl ester meperidina isonipecaine petidina Pethanol IDS-NP-001 Demerol |
|
| id |
CHEBI:6754 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H21NO2/c1-3-18-14(17)15(9-11-16(2)12-10-15)13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3 |
|
| inchikey |
XADCESSVHJOZHK-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
pethidine |
|
| mass |
247.338 |
|
| monoisotopicmass |
247.15723 |
|
| notation |
CHEBI:6754 |
|
| prefLabel |
pethidine |
|
| smiles |
C1(C(=O)OCC)(CCN(CC1)C)C2=CC=CC=C2 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_23990 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23990 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_6754 | PDRO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_6754 | FIDEO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_6754 | COVID-19 | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_6754 | OBIB | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_6754 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_6754 | DRON | SAME_URI | |
| http://www.co-ode.org/ontologies/galen#Pethidine | GALEN | LOOM | |
| http://purl.bioontology.org/ontology/RCD/x01Kn | RCD | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_6754 | OBIB | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_6754 | BERO | LOOM | |
| http://purl.bioontology.org/ontology/ATC/N02AB02 | ATC | LOOM |