loading...| Preferred Name |
mefenamic acid |
|
| Synonyms |
2-[(2,3-dimethylphenyl)amino]benzoic acid CI-473 INF-3355 acidum mefenamicum Ponstel N-(2,3-xylyl)-2-aminobenzoic acid N-2,3-xylylanthranilic acid INF 3355 CN 35355 Mefenaminsaeure acide mefenamique acido mefenamico mefenamic acid CN-35355 |
|
| Definitions |
An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,3-dimethylphenyl group. Although classed as a non-steroidal anti-inflammatory drug, its anti-inflammatory properties are considered to be minor. It is used to relieve mild to moderate pain, including headaches, dental pain, osteoarthritis and rheumatoid arthritis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6717 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:2684858 PDBeChem:ID8 PMID:14001132 PMID:22369458 PMID:28166217 PMID:3304401 PMID:4916242 PMID:425903 Wikipedia:Mefenamic_acid KEGG:D00151 Patent:US3138636 PMID:17330662 PMID:23494912 DrugBank:DB00784 LINCS:LSM-4085 PMID:4212650 PMID:6155061 PMID:577447 PMID:22275128 HMDB:HMDB0014922 PMID:23656341 Drug_Central:1663 CAS:61-68-7 PMID:23402341 KEGG:C02168 PMID:5286553 Patent:BE605302 Reaxys:2216243 |
|
| definition |
An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,3-dimethylphenyl group. Although classed as a non-steroidal anti-inflammatory drug, its anti-inflammatory properties are considered to be minor. It is used to relieve mild to moderate pain, including headaches, dental pain, osteoarthritis and rheumatoid arthritis. |
|
| formula |
C15H15NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_35544 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35480 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
| has_exact_synonym |
2-[(2,3-dimethylphenyl)amino]benzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
CI-473 INF-3355 acidum mefenamicum Ponstel N-(2,3-xylyl)-2-aminobenzoic acid N-2,3-xylylanthranilic acid INF 3355 CN 35355 Mefenaminsaeure acide mefenamique acido mefenamico mefenamic acid CN-35355 |
|
| id |
CHEBI:6717 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18) |
|
| inchikey |
HYYBABOKPJLUIN-UHFFFAOYSA-N |
|
| label |
mefenamic acid |
|
| mass |
241.28510 |
|
| monoisotopicmass |
241.11028 |
|
| notation |
CHEBI:6717 |
|
| prefLabel |
mefenamic acid |
|
| smiles |
Cc1cccc(Nc2ccccc2C(O)=O)c1C |
|
| treeView | ||
| subClassOf |