Preferred Name |
lorcaserin |
|
Synonyms |
(1R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine lorcaserin |
|
Definitions |
A benzazepine that is 2,3,4,5-tetrahydro-3-benzazepine substituted at position 1 by a methyl group and a t position 6 by a chloro group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_65353 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:9904422 Drug_Central:4374 CAS:616202-92-7 |
|
definition |
A benzazepine that is 2,3,4,5-tetrahydro-3-benzazepine substituted at position 1 by a methyl group and a t position 6 by a chloro group. |
|
formula |
C11H14ClN |
|
has role | ||
has_exact_synonym |
(1R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
lorcaserin |
|
id |
CHEBI:65353 |
|
in_subset | ||
inchi |
InChI=1S/C11H14ClN/c1-8-7-13-5-4-9-2-3-10(12)6-11(8)9/h2-3,6,8,13H,4-5,7H2,1H3/t8-/m0/s1 |
|
inchikey |
XTTZERNUQAFMOF-QMMMGPOBSA-N |
|
label |
lorcaserin |
|
mass |
195.68900 |
|
monoisotopicmass |
195.08148 |
|
notation |
CHEBI:65353 |
|
prefLabel |
lorcaserin |
|
smiles |
C[C@H]1CNCCc2ccc(Cl)cc12 |
|
treeView | ||
subClassOf |
Create mapping