loading...| Preferred Name |
lidocaine |
|
| Synonyms |
N-(2,6-dimethylphenyl)-N(2),N(2)-diethylglycinamide Lidocaine Lidoderm alpha-diethylamino-2,6-dimethylacetanilide 2-(Diethylamino)-2',6'-acetoxylidide 2-(Diethylamino)-N-(2,6-dimethylphenyl)acetamide |
|
| Definitions |
The monocarboxylic acid amide resulting from the formal condensation of N,N-diethylglycine with 2,6-dimethylaniline. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6456 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:US2441498 Patent:GB758224 DrugBank:DB00281 Wikipedia:Lidocaine Patent:GB706409 PMID:16668583 VSDB:1903 PMID:11106996 PMID:11120381 Drug_Central:1579 PMID:11692349 CAS:137-58-6 Beilstein:2215784 PMID:15056998 LINCS:LSM-3165 PMID:11431418 Reaxys:2215784 HMDB:HMDB0014426 PMID:17214917 PMID:18940244 KEGG:C07073 KEGG:D00358 |
|
| definition |
The monocarboxylic acid amide resulting from the formal condensation of N,N-diethylglycine with 2,6-dimethylaniline. |
|
| formula |
C14H22N2O |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_38070 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_36333 |
|
| has_exact_synonym |
N-(2,6-dimethylphenyl)-N(2),N(2)-diethylglycinamide Lidocaine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Lidoderm alpha-diethylamino-2,6-dimethylacetanilide 2-(Diethylamino)-2',6'-acetoxylidide 2-(Diethylamino)-N-(2,6-dimethylphenyl)acetamide |
|
| id |
CHEBI:6456 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) |
|
| inchikey |
NNJVILVZKWQKPM-UHFFFAOYSA-N |
|
| label |
lidocaine |
|
| mass |
234.33736 |
|
| monoisotopicmass |
234.17321 |
|
| notation |
CHEBI:6456 |
|
| prefLabel |
lidocaine |
|
| smiles |
CCN(CC)CC(=O)Nc1c(C)cccc1C |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_22712 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22712 |