loading...| Preferred Name |
levetiracetam |
|
| Synonyms |
Levetiracetam (2S)-2-(2-oxopyrrolidin-1-yl)butanamide Keppra levetiracetamum (-)-(S)-alpha-ethyl-2-oxo-1-pyrrolidineacetamide UCB-L 059 (S)-(-)-alpha-ethyl-2-oxo-1-pyrrolidineacetamide (S)-alpha-ethyl-2-oxo-1-pyrrolidineacetamide levetiracetam |
|
| Definitions |
A pyrrolidinone and carboxamide that is N-methylpyrrolidin-2-one in which one of the methyl hydrogens is replaced by an aminocarbonyl group, while another is replaced by an ethyl group (the S enantiomer). An anticonvulsant, it is used for the treatment of epilepsy in both human and veterinary medicine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6437 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22119754 Reaxys:8407472 DrugBank:DB01202 PMID:22321334 Drug_Central:1563 VSDB:2979 LINCS:LSM-5603 Wikipedia:Levetiracetam KEGG:C07841 CAS:102767-28-2 KEGG:D00709 |
|
| definition |
A pyrrolidinone and carboxamide that is N-methylpyrrolidin-2-one in which one of the methyl hydrogens is replaced by an aminocarbonyl group, while another is replaced by an ethyl group (the S enantiomer). An anticonvulsant, it is used for the treatment of epilepsy in both human and veterinary medicine. |
|
| formula |
C8H14N2O2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| has_exact_synonym |
Levetiracetam (2S)-2-(2-oxopyrrolidin-1-yl)butanamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Keppra levetiracetamum (-)-(S)-alpha-ethyl-2-oxo-1-pyrrolidineacetamide UCB-L 059 (S)-(-)-alpha-ethyl-2-oxo-1-pyrrolidineacetamide (S)-alpha-ethyl-2-oxo-1-pyrrolidineacetamide levetiracetam |
|
| id |
CHEBI:6437 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H14N2O2/c1-2-6(8(9)12)10-5-3-4-7(10)11/h6H,2-5H2,1H3,(H2,9,12)/t6-/m0/s1 |
|
| inchikey |
HPHUVLMMVZITSG-LURJTMIESA-N |
|
| label |
levetiracetam |
|
| mass |
170.20900 |
|
| monoisotopicmass |
170.10553 |
|
| notation |
CHEBI:6437 |
|
| prefLabel |
levetiracetam |
|
| smiles |
CC[C@H](N1CCCC1=O)C(N)=O |
|
| treeView | ||
| subClassOf |