Preferred Name |
isoprenaline |
|
Synonyms |
Isoprenaline 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol (+-)-isoprenaline 3,4-dihydroxy-alpha-[(isopropylamino)methyl]benzyl alcohol 1-(3,4-dihydroxyphenyl)-2-isopropylaminoethanol N-isopropyl-beta-dihydroxyphenyl-beta-hydroxyethylamine isoprenalinum isopropyl noradrenaline 1-(3,4-dihydroxyphenyl)-2-(isopropylamino)ethanol N-isopropylnoradrenaline N-isopropylnorepinephrine isoprenalina alpha-(isopropylaminomethyl)protocatechuyl alcohol isoprenaline (+-)-isoproterenol isoproterenol |
|
Definitions |
A secondary amino compound that is noradrenaline in which one of the hydrogens attached to the nitrogen is replaced by an isopropyl group. A sympathomimetic acting almost exclusively on beta-adrenergic receptors, it is used (mainly as the hydrochloride salt) as a bronghodilator and heart stimulant for the management of a variety of cardiac disorders. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_64317 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB01064 LINCS:LSM-4311 KEGG:D08090 KEGG:C07056 Reaxys:2213857 Patent:DE723278 Wikipedia:Isoprenaline Patent:US2308232 CAS:7683-59-2 Drug_Central:1499 |
|
definition |
A secondary amino compound that is noradrenaline in which one of the hydrogens attached to the nitrogen is replaced by an isopropyl group. A sympathomimetic acting almost exclusively on beta-adrenergic receptors, it is used (mainly as the hydrochloride salt) as a bronghodilator and heart stimulant for the management of a variety of cardiac disorders. |
|
formula |
C11H17NO3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35522 |
|
has_exact_synonym |
Isoprenaline 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+-)-isoprenaline 3,4-dihydroxy-alpha-[(isopropylamino)methyl]benzyl alcohol 1-(3,4-dihydroxyphenyl)-2-isopropylaminoethanol N-isopropyl-beta-dihydroxyphenyl-beta-hydroxyethylamine isoprenalinum isopropyl noradrenaline 1-(3,4-dihydroxyphenyl)-2-(isopropylamino)ethanol N-isopropylnoradrenaline N-isopropylnorepinephrine isoprenalina alpha-(isopropylaminomethyl)protocatechuyl alcohol isoprenaline (+-)-isoproterenol isoproterenol |
|
id |
CHEBI:64317 |
|
in_subset | ||
inchi |
InChI=1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3 |
|
inchikey |
JWZZKOKVBUJMES-UHFFFAOYSA-N |
|
label |
isoprenaline |
|
mass |
211.25760 |
|
monoisotopicmass |
211.12084 |
|
notation |
CHEBI:64317 |
|
prefLabel |
isoprenaline |
|
smiles |
CC(C)NCC(O)c1ccc(O)c(O)c1 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_50995 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 |