loading...| Preferred Name |
spiramide |
|
| Synonyms |
8-[3-(4-fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one spiramide AMI-193 espiramida spiramidum |
|
| Definitions |
An azaspiro compound that consists of 1,3,8-triazaspiro[4.5]decan-4-one having a phenyl group attached to N-1 and a 3-(4-fluorophenoxy)propyl attached to N-8. Selective 5-HT antagonist, which binds to 5-HT2 sites as potently as spiperone but has lower affinity for 5-HT2C receptors. Also a high affinity D2 receptor antagonist (Ki = 3 nM). Lacks the disruptive effect of spiperone on animal behaviour. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_64207 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:11124389 PMID:4474849 PMID:19875674 Patent:US3238216 LINCS:LSM-4124 PMID:17965538 CAS:510-74-7 Wikipedia:Spiramide Reaxys:631679 PMID:4776656 |
|
| definition |
An azaspiro compound that consists of 1,3,8-triazaspiro[4.5]decan-4-one having a phenyl group attached to N-1 and a 3-(4-fluorophenoxy)propyl attached to N-8. Selective 5-HT antagonist, which binds to 5-HT2 sites as potently as spiperone but has lower affinity for 5-HT2C receptors. Also a high affinity D2 receptor antagonist (Ki = 3 nM). Lacks the disruptive effect of spiperone on animal behaviour. |
|
| formula |
C22H26FN3O2 |
|
| has role | ||
| has_exact_synonym |
8-[3-(4-fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
spiramide AMI-193 espiramida spiramidum |
|
| id |
CHEBI:64207 |
|
| in_subset | ||
| inchi |
InChI=1S/C22H26FN3O2/c23-18-7-9-20(10-8-18)28-16-4-13-25-14-11-22(12-15-25)21(27)24-17-26(22)19-5-2-1-3-6-19/h1-3,5-10H,4,11-17H2,(H,24,27) |
|
| inchikey |
FJUKDAZEABGEIH-UHFFFAOYSA-N |
|
| label |
spiramide |
|
| mass |
383.45910 |
|
| monoisotopicmass |
383.20091 |
|
| notation |
CHEBI:64207 |
|
| prefLabel |
spiramide |
|
| smiles |
Fc1ccc(OCCCN2CCC3(CC2)N(CNC3=O)c2ccccc2)cc1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_35624 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_35624 |