Preferred Name |
tinidazole |
|
Synonyms |
1-[2-(ethylsulfonyl)ethyl]-2-methyl-5-nitro-1H-imidazole timidazole |
|
Definitions |
1H-imidazole substituted at C-1 by a (2-ethylsulfonyl)ethyl group, at C-2 by a methyl group and at C-5 by a nitro group. It is used as an antiprotozoal, antibacterial agent. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63627 |
|
charge |
0 |
|
database_cross_reference |
PMID:5458368 Patent:US3376311 Drug_Central:2671 Wikipedia:Tinidazole Reaxys:618182 KEGG:D01426 LINCS:LSM-5948 DrugBank:DB00911 |
|
definition |
1H-imidazole substituted at C-1 by a (2-ethylsulfonyl)ethyl group, at C-2 by a methyl group and at C-5 by a nitro group. It is used as an antiprotozoal, antibacterial agent. |
|
formula |
C8H13N3O4S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35820 http://purl.obolibrary.org/obo/CHEBI_36047 |
|
has_alternative_id |
CHEBI:32227 |
|
has_exact_synonym |
1-[2-(ethylsulfonyl)ethyl]-2-methyl-5-nitro-1H-imidazole |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
timidazole |
|
id |
CHEBI:63627 |
|
in_subset | ||
inchi |
InChI=1S/C8H13N3O4S/c1-3-16(14,15)5-4-10-7(2)9-6-8(10)11(12)13/h6H,3-5H2,1-2H3 |
|
inchikey |
HJLSLZFTEKNLFI-UHFFFAOYSA-N |
|
label |
tinidazole |
|
mass |
247.27200 |
|
monoisotopicmass |
247.06268 |
|
notation |
CHEBI:63627 |
|
prefLabel |
tinidazole |
|
smiles |
CCS(=O)(=O)CCn1c(C)ncc1[N+]([O-])=O |
|
treeView | ||
subClassOf |