loading...| Preferred Name |
sotalol |
|
| Synonyms |
N-{4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl}methanesulfonamide Sotalol beta-cardone sotalol sotalolum 4'-(1-hydroxy-2-(isopropylamino)ethyl)methane sulfonanilide |
|
| Definitions |
A sulfonamide that is N-phenylmethanesulfonamide in which the phenyl group is substituted at position 4 by a 1-hydroxy-2-(isopropylamino)ethyl group. It has both beta-adrenoreceptor blocking (Vaughan Williams Class II) and cardiac action potential duration prolongation (Vaughan Williams Class III) antiarrhythmic properties. It is used (usually as the hydrochloride salt) for the management of ventricular and supraventricular arrhythmias. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63622 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:3930-20-9 Drug_Central:2464 Reaxys:2380820 HMDB:HMDB0014632 PMID:21553267 KEGG:C07309 KEGG:D08525 PMID:21854895 DrugBank:DB00489 LINCS:LSM-1465 Wikipedia:Sotalol PMID:20562595 |
|
| definition |
A sulfonamide that is N-phenylmethanesulfonamide in which the phenyl group is substituted at position 4 by a 1-hydroxy-2-(isopropylamino)ethyl group. It has both beta-adrenoreceptor blocking (Vaughan Williams Class II) and cardiac action potential duration prolongation (Vaughan Williams Class III) antiarrhythmic properties. It is used (usually as the hydrochloride salt) for the management of ventricular and supraventricular arrhythmias. |
|
| formula |
C12H20N2O3S |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_38070 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| has_alternative_id |
CHEBI:9206 |
|
| has_exact_synonym |
N-{4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl}methanesulfonamide Sotalol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
beta-cardone sotalol sotalolum 4'-(1-hydroxy-2-(isopropylamino)ethyl)methane sulfonanilide |
|
| id |
CHEBI:63622 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H20N2O3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3 |
|
| inchikey |
ZBMZVLHSJCTVON-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
sotalol |
|
| mass |
272.36400 |
|
| monoisotopicmass |
272.11946 |
|
| notation |
CHEBI:63622 |
|
| prefLabel |
sotalol |
|
| smiles |
CC(C)NCC(O)c1ccc(NS(C)(=O)=O)cc1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35358 http://purl.obolibrary.org/obo/CHEBI_50995 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 http://purl.obolibrary.org/obo/CHEBI_50995 |