loading...| Preferred Name |
rasagiline |
|
| Synonyms |
(1R)-N-(prop-2-yn-1-yl)indan-1-amine (R)-N-2-Propynyl-1-indanamine (1R)-N-propargylindan-1-amine rasagiline RAS (R)-indan-1-yl-prop-2-ynyl-amine |
|
| Definitions |
An indane that consists of 1-aminoindane bearing an N-propargyl substituent. A selective, irreversible monoamine oxidase-B inhibitor. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63620 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01367 CAS:136236-51-6 PMID:21971007 PMID:21628600 PMID:21864207 PMID:21878836 Reaxys:9194207 PMID:21819487 PMID:21671840 PMID:20577110 KEGG:D08469 PMID:21895884 PMID:21500280 PMID:21482191 PMID:21946113 PMID:21953831 Wikipedia:Rasagiline PMID:22065207 PMID:21971006 PMID:22045282 |
|
| definition |
An indane that consists of 1-aminoindane bearing an N-propargyl substituent. A selective, irreversible monoamine oxidase-B inhibitor. |
|
| formula |
C12H13N |
|
| has role | ||
| has_exact_synonym |
(1R)-N-(prop-2-yn-1-yl)indan-1-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(R)-N-2-Propynyl-1-indanamine (1R)-N-propargylindan-1-amine rasagiline RAS (R)-indan-1-yl-prop-2-ynyl-amine |
|
| id |
CHEBI:63620 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H13N/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12/h1,3-6,12-13H,7-9H2/t12-/m1/s1 |
|
| inchikey |
RUOKEQAAGRXIBM-GFCCVEGCSA-N |
|
| label |
rasagiline |
|
| mass |
171.23830 |
|
| monoisotopicmass |
171.10480 |
|
| notation |
CHEBI:63620 |
|
| prefLabel |
rasagiline |
|
| smiles |
C#CCN[C@@H]1CCc2ccccc12 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_73477 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_73477 |