loading...| Preferred Name |
linezolid |
|
| Synonyms |
N-({(5S)-3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide Linezolid N-(((S)-3-(3-Fluoro-4-morpholinophenyl)-2-oxo-5-oxazolidinyl)methyl)acetamide linezolid |
|
| Definitions |
An organofluorine compound that consists of 1,3-oxazolidin-2-one bearing an N-3-fluoro-4-(morpholin-4-yl)phenyl group as well as an acetamidomethyl group at position 5. A synthetic antibacterial agent that inhibits bacterial protein synthesis by binding to a site on 23S ribosomal RNA of the 50S subunit and prevents further formation of a functional 70S initiation complex. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63607 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:1584 PMID:21740298 Patent:WO957271 KEGG:C08146 DrugBank:DB00601 PMID:22139199 Patent:US5688792 KEGG:D00947 PMID:22247123 PMID:22134348 PDBeChem:ZLD PMID:22230331 PMID:22037854 Reaxys:7496939 PMID:21815204 Wikipedia:Linezolid LINCS:LSM-5750 CAS:165800-03-3 PMID:22214776 PMID:22110086 PMID:22064542 PMID:21899392 PMID:22064533 |
|
| definition |
An organofluorine compound that consists of 1,3-oxazolidin-2-one bearing an N-3-fluoro-4-(morpholin-4-yl)phenyl group as well as an acetamidomethyl group at position 5. A synthetic antibacterial agent that inhibits bacterial protein synthesis by binding to a site on 23S ribosomal RNA of the 50S subunit and prevents further formation of a functional 70S initiation complex. |
|
| formula |
C16H20FN3O4 |
|
| has role | ||
| has_alternative_id |
CHEBI:6477 |
|
| has_exact_synonym |
N-({(5S)-3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide Linezolid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-(((S)-3-(3-Fluoro-4-morpholinophenyl)-2-oxo-5-oxazolidinyl)methyl)acetamide linezolid |
|
| id |
CHEBI:63607 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 |
|
| inchikey |
TYZROVQLWOKYKF-ZDUSSCGKSA-N |
|
| label |
linezolid |
|
| mass |
337.34610 |
|
| monoisotopicmass |
337.14378 |
|
| notation |
CHEBI:63607 |
|
| prefLabel |
linezolid |
|
| smiles |
CC(=O)NC[C@H]1CN(C(=O)O1)c1ccc(N2CCOCC2)c(F)c1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_22160 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_22160 |