Preferred Name |
magnesium acetate |
|
Synonyms |
Magnesium di(acetate) Mg Acetate Acetic acid, magnesium salt (2:1) magnesium diacetate Mg(II) acetate acetic acid magnesium salt |
|
Definitions |
The magnesium salt of acetic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_62964 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:3692530 CAS:142-72-3 |
|
definition |
The magnesium salt of acetic acid. |
|
formula |
C4H6MgO4 |
|
has functional parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Magnesium di(acetate) Mg Acetate Acetic acid, magnesium salt (2:1) magnesium diacetate Mg(II) acetate acetic acid magnesium salt |
|
id |
CHEBI:62964 |
|
in_subset | ||
inchi |
InChI=1S/2C2H4O2.Mg/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
|
inchikey |
UEGPKNKPLBYCNK-UHFFFAOYSA-L |
|
label |
magnesium acetate |
|
mass |
142.39300 |
|
monoisotopicmass |
142.01165 |
|
notation |
CHEBI:62964 |
|
prefLabel |
magnesium acetate |
|
smiles |
[Mg++].CC([O-])=O.CC([O-])=O |
|
treeView | ||
subClassOf |
Create mapping