loading...| Preferred Name |
ammonium acetate |
|
| Synonyms |
ammonium acetate E-264 acetic acid, ammonium salt AcONH4 ammonium ethanoate E 264 azanium acetate INS No. 264 CH3CO2NH4 CH3COONH4 E264 NH4OAc |
|
| Definitions |
An ammonium salt obtained by reaction of ammonia with acetic acid. A deliquescent white crystalline solid, it has a relatively low melting point (114degreeC) for a salt. Used as a food acidity regulator, although no longer approved for this purpose in the EU. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_62947 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21165426 Wikipedia:Ammonium_acetate Reaxys:3564799 Reaxys:10774525 PPDB:32 PMID:1180897 CAS:631-61-8 |
|
| definition |
An ammonium salt obtained by reaction of ammonia with acetic acid. A deliquescent white crystalline solid, it has a relatively low melting point (114degreeC) for a salt. Used as a food acidity regulator, although no longer approved for this purpose in the EU. |
|
| formula |
C2H7NO2 |
|
| has role | ||
| has_exact_synonym |
ammonium acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
E-264 acetic acid, ammonium salt AcONH4 ammonium ethanoate E 264 azanium acetate INS No. 264 CH3CO2NH4 CH3COONH4 E264 NH4OAc |
|
| id |
CHEBI:62947 |
|
| in_subset | ||
| inchi |
InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3 |
|
| inchikey |
USFZMSVCRYTOJT-UHFFFAOYSA-N |
|
| label |
ammonium acetate |
|
| mass |
77.08250 |
|
| monoisotopicmass |
77.04768 |
|
| notation |
CHEBI:62947 |
|
| prefLabel |
ammonium acetate |
|
| smiles |
[NH4+].CC([O-])=O |
|
| treeView | ||
| subClassOf |