Jump to:
loading...| Preferred Name |
calcium oxalate |
|
| Synonyms |
calcium oxalate |
|
| Definitions |
The calcium salt of oxalic acid, which in excess in the urine may lead to formation of oxalate calculi (kidney stones). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_60579 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C17478 Reaxys:3915709 CAS:563-72-4 |
|
| definition |
The calcium salt of oxalic acid, which in excess in the urine may lead to formation of oxalate calculi (kidney stones). |
|
| formula |
C2CaO4 |
|
| has part | ||
| has_exact_synonym |
calcium oxalate |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:60579 |
|
| in_subset | ||
| inchi |
InChI=1S/C2H2O4.Ca/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
|
| inchikey |
QXDMQSPYEZFLGF-UHFFFAOYSA-L |
|
| label |
calcium oxalate |
|
| mass |
128.09700 |
|
| monoisotopicmass |
127.94225 |
|
| notation |
CHEBI:60579 |
|
| prefLabel |
calcium oxalate |
|
| smiles |
[Ca++].[O-]C(=O)C([O-])=O |
|
| treeView | ||
| subClassOf |
Create mapping