loading...| Preferred Name |
moxalactam |
|
| Synonyms |
Moxalactam (6R,7R)-7-{[carboxy(4-hydroxyphenyl)acetyl]amino}-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Oxa-cephem Latamoxef festamoxin latamoxefum Lamoxactam latamoxef LMOX |
|
| Definitions |
A broad-spectrum oxacephem antibiotic in which the oxazine ring is substituted with a tetrazolylthiomethyl group and the azetidinone ring carries methoxy and 2-carboxy-2-(4-hydroxyphenyl)acetamido substituents. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_599928 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:4222777 PMID:6129432 Patent:US413486 KEGG:D08109 Drug_Central:1851 PMID:24956910 PMID:6217353 CAS:64952-97-2 HMDB:HMDB0015574 Beilstein:4222777 PDBeChem:MXL DrugBank:DB04570 Patent:DE2713370 PMID:3296254 KEGG:C07231 PMID:3477883 PMID:3778044 PMID:9131470 PMID:29017833 |
|
| definition |
A broad-spectrum oxacephem antibiotic in which the oxazine ring is substituted with a tetrazolylthiomethyl group and the azetidinone ring carries methoxy and 2-carboxy-2-(4-hydroxyphenyl)acetamido substituents. |
|
| formula |
C20H20N6O9S |
|
| has role | ||
| has_alternative_id |
CHEBI:44113 CHEBI:214506 CHEBI:7006 |
|
| has_exact_synonym |
Moxalactam (6R,7R)-7-{[carboxy(4-hydroxyphenyl)acetyl]amino}-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Oxa-cephem Latamoxef festamoxin latamoxefum Lamoxactam latamoxef LMOX |
|
| id |
CHEBI:599928 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H20N6O9S/c1-25-19(22-23-24-25)36-8-10-7-35-18-20(34-2,17(33)26(18)13(10)16(31)32)21-14(28)12(15(29)30)9-3-5-11(27)6-4-9/h3-6,12,18,27H,7-8H2,1-2H3,(H,21,28)(H,29,30)(H,31,32)/t12?,18-,20+/m1/s1 |
|
| inchikey |
JWCSIUVGFCSJCK-CAVRMKNVSA-N |
|
| label |
moxalactam |
|
| mass |
520.47300 |
|
| monoisotopicmass |
520.10125 |
|
| notation |
CHEBI:599928 |
|
| prefLabel |
moxalactam |
|
| smiles |
CO[C@]1(NC(=O)C(C(O)=O)c2ccc(O)cc2)[C@H]2OCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O |
|
| treeView | ||
| subClassOf |