loading...| Preferred Name |
hydroflumethiazide |
|
| Synonyms |
Hydroflumethiazide 6-(trifluoromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide hidroflumetiazida hydroflumethiazidum trifluoromethylhydrothiazide hydroflumethiazide |
|
| Definitions |
A benzothiadiazine consisting of a 3,4-dihydro-HH-1,2,4-benzothiadiazine bicyclic system dioxygenated on sulfur and carrying trifluoromethyl and aminosulfonyl groups at positions 6 and 7 respectively. A diuretic with actions and uses similar to those of hydrochlorothiazide. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5784 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C07763 Wikipedia:Hydroflumethiazide KEGG:D00654 PMID:14407732 LINCS:LSM-5497 Drug_Central:1392 PMID:477714 PMID:2490778 PMID:632365 Reaxys:342692 CAS:135-09-1 PMID:29438107 |
|
| definition |
A benzothiadiazine consisting of a 3,4-dihydro-HH-1,2,4-benzothiadiazine bicyclic system dioxygenated on sulfur and carrying trifluoromethyl and aminosulfonyl groups at positions 6 and 7 respectively. A diuretic with actions and uses similar to those of hydrochlorothiazide. |
|
| formula |
C8H8F3N3O4S2 |
|
| has role | ||
| has_exact_synonym |
Hydroflumethiazide 6-(trifluoromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
hidroflumetiazida hydroflumethiazidum trifluoromethylhydrothiazide hydroflumethiazide |
|
| id |
CHEBI:5784 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H8F3N3O4S2/c9-8(10,11)4-1-5-7(2-6(4)19(12,15)16)20(17,18)14-3-13-5/h1-2,13-14H,3H2,(H2,12,15,16) |
|
| inchikey |
DMDGGSIALPNSEE-UHFFFAOYSA-N |
|
| label |
hydroflumethiazide |
|
| mass |
331.295 |
|
| monoisotopicmass |
330.99083 |
|
| notation |
CHEBI:5784 |
|
| prefLabel |
hydroflumethiazide |
|
| smiles |
C12=C(C=C(S(N)(=O)=O)C(=C1)C(F)(F)F)S(NCN2)(=O)=O |
|
| treeView | ||
| subClassOf |