Preferred Name |
cephapirin |
|
Synonyms |
(6R,7R)-3-acetoxymethyl-7-[(pyridin-4-ylsulfanyl)acetamido]-3,4-didehydrocepham-4-carboxylic acid cefapirinum cefapirina cefapirine CEPR Cephapirine Cefaprin (6R,7R)-3-(acetoxymethyl)-8-oxo-7-{[(pyridin-4-ylsulfanyl)acetyl]amino}-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid cefapirin |
|
Definitions |
A cephalosporin with acetoxymethyl and 2(pyridin-4-ylsulfanyl)acetamido substituents at positions 3 and 7, respectively, of the cephem skeleton. It is used (as its sodium salt) as an antibiotic, being effective against gram-negative and gram-positive organisms. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_554446 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:575 HMDB:HMDB0030451 HMDB:HMDB0015270 PMID:24224523 KEGG:D07636 Beilstein:4031996 Reaxys:4031966 VSDB:1845 PMID:19246140 Wikipedia:Cephapirin CAS:21593-23-7 DrugBank:DB01139 PMID:2083978 PMID:23948762 PMID:29017833 KEGG:C06896 |
|
definition |
A cephalosporin with acetoxymethyl and 2(pyridin-4-ylsulfanyl)acetamido substituents at positions 3 and 7, respectively, of the cephem skeleton. It is used (as its sodium salt) as an antibiotic, being effective against gram-negative and gram-positive organisms. |
|
formula |
C17H17N3O6S2 |
|
has role | ||
has_alternative_id |
CHEBI:3544 |
|
has_exact_synonym |
(6R,7R)-3-acetoxymethyl-7-[(pyridin-4-ylsulfanyl)acetamido]-3,4-didehydrocepham-4-carboxylic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
cefapirinum cefapirina cefapirine CEPR Cephapirine Cefaprin (6R,7R)-3-(acetoxymethyl)-8-oxo-7-{[(pyridin-4-ylsulfanyl)acetyl]amino}-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid cefapirin |
|
id |
CHEBI:554446 |
|
in_subset | ||
inchi |
InChI=1S/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1 |
|
inchikey |
UQLLWWBDSUHNEB-CZUORRHYSA-N |
|
is conjugate acid of | ||
label |
cephapirin |
|
mass |
423.46300 |
|
monoisotopicmass |
423.05588 |
|
notation |
CHEBI:554446 |
|
prefLabel |
cephapirin |
|
smiles |
[H][C@]12SCC(COC(C)=O)=C(N1C(=O)[C@H]2NC(=O)CSc1ccncc1)C(O)=O |
|
treeView | ||
subClassOf |