Preferred Name |
epinastine |
|
Synonyms |
9,13b-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepin-3-amine epinastina (+-)-epinastine epinastinum epinastine 3-amino-9,13b-dihydro-1H-dibenz(c,f)imidazo(1,5-a)azepine |
|
Definitions |
A benzazepine that is 6,11-dihydro-5H-dibenzo[b,e]azepine in which the azepine ring is fused to the e side of 4,5-dihydro-1H-imidazol-2-amine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_51032 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:3593307 KEGG:D07900 Reaxys:3593307 Wikipedia:Epinastine CAS:80012-43-7 DrugBank:DB00751 Patent:US4313931 Patent:GB2071095 Drug_Central:1027 |
|
definition |
A benzazepine that is 6,11-dihydro-5H-dibenzo[b,e]azepine in which the azepine ring is fused to the e side of 4,5-dihydro-1H-imidazol-2-amine. |
|
formula |
C16H15N3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_37956 |
|
has_exact_synonym |
9,13b-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepin-3-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
epinastina (+-)-epinastine epinastinum epinastine 3-amino-9,13b-dihydro-1H-dibenz(c,f)imidazo(1,5-a)azepine |
|
id |
CHEBI:51032 |
|
in_subset | ||
inchi |
InChI=1S/C16H15N3/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16/h1-8,15H,9-10H2,(H2,17,18) |
|
inchikey |
WHWZLSFABNNENI-UHFFFAOYSA-N |
|
label |
epinastine |
|
mass |
249.31040 |
|
monoisotopicmass |
249.12660 |
|
notation |
CHEBI:51032 |
|
prefLabel |
epinastine |
|
smiles |
NC1=NCC2N1c1ccccc1Cc1ccccc21 |
|
treeView | ||
subClassOf |