Preferred Name |
diazepam |
|
Synonyms |
Diazepam 7-chloro-1-methyl-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one methyl diazepinone Valium 7-chloro-1,3-dihydro-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one |
|
Definitions |
A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a chloro group at position 7, a methyl group at position 1 and a phenyl group at position 5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_49575 |
|
charge |
0 |
|
database_cross_reference |
PMID:16365514 LINCS:LSM-2359 Gmelin:124061 VSDB:2972 Beilstein:754371 Wikipedia:Diazepam KEGG:C06948 Drug_Central:852 HMDB:HMDB0014967 PDBeChem:DZP KEGG:D00293 PMID:16780966 Reaxys:754371 CAS:439-14-5 DrugBank:DB00829 PMID:11925051 |
|
definition |
A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a chloro group at position 7, a methyl group at position 1 and a phenyl group at position 5. |
|
formula |
C16H13ClN2O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35474 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35717 |
|
has_alternative_id |
CHEBI:4494 CHEBI:49574 |
|
has_exact_synonym |
Diazepam 7-chloro-1-methyl-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
methyl diazepinone Valium 7-chloro-1,3-dihydro-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one |
|
id |
CHEBI:49575 |
|
in_subset | ||
inchi |
InChI=1S/C16H13ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
|
inchikey |
AAOVKJBEBIDNHE-UHFFFAOYSA-N |
|
label |
diazepam |
|
mass |
284.74000 |
|
monoisotopicmass |
284.07164 |
|
notation |
CHEBI:49575 |
|
prefLabel |
diazepam |
|
smiles |
CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc12 |
|
treeView | ||
subClassOf |