loading...| Preferred Name |
etomidate |
|
| Synonyms |
Etomidate ethyl 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylate (+)-etomidate etomidatum etomidate (+)-ethyl 1-(alpha-methylbenzyl)imidazole-5-carboxylate R-(+)-ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate (R)-(+)-1-(alpha-methylbenzyl)imidazole-5-carboxylic acid ethyl ester etomidato 3-((R)-1-Phenyl-ethyl)-3H-imidazole-4-carboxylic acid ethyl ester (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylic acid ethyl ester |
|
| Definitions |
The ethyl ester of 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylic acid. It is an intravenous general anaesthetic with no analgesic activity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4910 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-37126 PMID:18348518 KEGG:D00548 Drug_Central:1109 Patent:US3991072 CAS:33125-97-2 Patent:DE2609573 DrugBank:DB00292 PMID:12646036 KEGG:C07522 |
|
| definition |
The ethyl ester of 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylic acid. It is an intravenous general anaesthetic with no analgesic activity. |
|
| formula |
C14H16N2O2 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:129090 |
|
| has_exact_synonym |
Etomidate ethyl 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+)-etomidate etomidatum etomidate (+)-ethyl 1-(alpha-methylbenzyl)imidazole-5-carboxylate R-(+)-ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate (R)-(+)-1-(alpha-methylbenzyl)imidazole-5-carboxylic acid ethyl ester etomidato 3-((R)-1-Phenyl-ethyl)-3H-imidazole-4-carboxylic acid ethyl ester (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylic acid ethyl ester |
|
| id |
CHEBI:4910 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H16N2O2/c1-3-18-14(17)13-9-15-10-16(13)11(2)12-7-5-4-6-8-12/h4-11H,3H2,1-2H3/t11-/m1/s1 |
|
| inchikey |
NPUKDXXFDDZOKR-LLVKDONJSA-N |
|
| label |
etomidate |
|
| mass |
244.28900 |
|
| monoisotopicmass |
244.12118 |
|
| notation |
CHEBI:4910 |
|
| prefLabel |
etomidate |
|
| smiles |
CCOC(=O)c1cncn1[C@H](C)c1ccccc1 |
|
| treeView | ||
| subClassOf |